Index: UI/Lib/Dlg/TErrorList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TErrorList.cls.xml (revision 0) +++ UI/Lib/Dlg/TErrorList.cls.xml (revision 61) @@ -0,0 +1,420 @@ + + + +serial +MakovaDrawTextCnts +Default +%Library.TMFormClass + + +%Library.Integer + + + +%Library.Integer + + + +%Library.TMForm + + + +%Library.String +"False" + + + +%TMShape + + + +%TMSpeedButton + + + +%TMListBox + + + +%TMLabel + + + +%Library.TMIcon + + + +initvalue:%String +0 +%Status + + + + +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication + + + + +initvalue:%String +0 +%Library.Status + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +ListBox1 + + +Shape1 + + +SpeedButton1 + + +lblMessage + + +BaseX + + +BaseY + + +Moving + + +Shape + + +btnOk + + +lbErrors + + +tmpIcon + + + + + Index: UI/Lib/Dlg/TSetupLevelsTree.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TSetupLevelsTree.cls.xml (revision 0) +++ UI/Lib/Dlg/TSetupLevelsTree.cls.xml (revision 61) @@ -0,0 +1,1358 @@ + + + +serial +UISetupLevelTree +Default +%Library.TMFormClass + + +%Library.Integer +0 + + + +%Library.TMForm + + + +%Library.List + + + +%Library.TMStringList + + + + +Huidige LevelDepth (let wel: ook unchecked levels tellen mee) +%Library.String +0 + + + +%Library.Integer +5 + + + +%Library.List + + + + +Wanneer een preset wordt gekozen uit de combobox, dan wordt het ID (dat +gekoppeld is via het data-veld) onthouden in dit property. + +Echter wanneer de structuur van de levels wordt gewijzigd door de gebruiker +(toevoegen,verwijderen,nieuw) dan is het ID dat onthouden werd niet meer +representatief voor hetgeen op het scherm staat, dus bij die user-acties zal +de property leeg gemaakt worden. +%Library.String +0 + + + +%Library.List + + + +%TMShape + + + +%TMShape + + + +%TMShape + + + +%Library.String +1 + + + +%Library.String +1 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMPanel + + + +%TMScrollBox + + + +initvalue:%String +0 +%Status + + + + + +$LB($LB(key1,key2,...,keyx),PresetNaam) +PresetNaam,PresetKeys:%String,PresetID:%String="" +0 + + + + +0 + + + + +0 + + + + +Args:%String +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication + + + + +initvalue:%String +0 +%Library.Status + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +0 +%Library.Integer + + + + +0 +%Library.Boolean +0 Do + . New Msg + . Set Msg="Deze opdracht verwijdert de huidige instellingen!"_$C(13,10) + . Set Msg=Msg_"Bent u zeker dat u wilt doorgaan?" + . Set tmpAnswer=MApplication.MessageBox(Msg,..Form.Caption,$$$MBICONQUESTION+$$$MBOKCANCEL+$$$MBDEFBUTTON2) + + Quit:(tmpAnswer=$$$mrCancel) 0 + + Do ..lbDeleteLevelBoxes() + + Quit 1 + +]]> + + + +0 +CAPTION, KEY->$LB + Do ComboBox.FillItems(..INTranslations.Text,..INKeys) + ;CATEGORY->DATA (lijnen worden getekend bij overgang van categorie: zie ...cbbDrawItem) + New Loop + For Loop=0:1:..INTranslations.Count-1 Do + . Do ComboBox.Items.SetObjects(Loop,..INTranslations.GetObjects(Loop)) + Set ComboBox.OnChangeItem=$LB(%this,"dCOMPEVENTcbbLevelOnChange") + Set ComboBox.OnDrawItem=$LB(%this,"dCOMPEVENTcbbDrawItem") + Set ComboBox.Tag=Panel ;PARENT + Set ComboBox.DropDownCount=18 + Set ..aLBCONTAINER(Panel,$$$lbcComboBox)=ComboBox + + ;---=[CHECKBOX]=--- + New CheckBox + Set CheckBox=##class(%TMCheckBox).%New($LB(Panel.Address,0)) + Set CheckBox.Left=8 + Set CheckBox.Top=30 + Set CheckBox.Width=16 + Set CheckBox.Height=16 + Set CheckBox.OnClick=$LB(%this,"dCOMPEVENTchkLevelClick") + Set CheckBox.Tag=Panel ;PARENT + Set CheckBox.Checked="True" + Set ..aLBCONTAINER(Panel,$$$lbcCheckBox)=CheckBox + + ;Beschikbaar stellen voor gebruik + Set ..aLBCONTAINER(Panel,$$$lbcIsAvailable)=1 + Set ..aLBCONTAINER(Panel,$$$lbcIsSelected)=0 + + Quit + +]]> + + + +0 + + + + +0 + + + + +0 + + + + +Key:%String +0 + + + + +0 + + + + +0 +"": ReOrganizeLevelBoxes") Quit + + Do ..lbUpdateVolgNrs() + + Quit + +]]> + + + +Level:%Integer +0 + + + + +Keys:%List +0 + + + + +LevelBox:%String,Selected:%Boolean +0 + + + + +0 + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +Button1 + + +TreeView1 + + +DraggingObject + + +Button2 + + +Button3 + + +Button4 + + +CheckBox1 + + +ComboBox1 + + +Label1 + + +Panel1 + + +Dock1 + + +ScrollBox1 + + +SpeedButton1 + + +SpeedButton2 + + +SpeedButton3 + + +Toolbar1 + + +cbbLevelName + + +chkLevelAvailable + + +lblLevelNr + + +sbLevelContainer + + +btnToevoegen + + +btnAfsluiten + + +btnVerwijderen + + +dckTop + + +tbTop + + +DraggingPanel + + +Panel2 + + +MAXLevelCount + + +LevelCount + + +LevelItems + + +LevelKeys + + +InitKeys + + +ToolbarSep1 + + +ToolbarSep2 + + +btnNieuw + + +ResultKeys + + +btnCancel + + +cbbPresets + + +ResultKeysTranslation + + +PresetKeys + + +pnlControls + + +INKeys + + +INTranslations + + +OUTKeys + + +OUTTranslations + + +Shape1 + + +Shape2 + + +Shape3 + + +OUTPresetID + + + + + Index: UI/Lib/Ctrl/TDAEdit.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TDAEdit.cls.xml (revision 0) +++ UI/Lib/Ctrl/TDAEdit.cls.xml (revision 61) @@ -0,0 +1,969 @@ + + + +serial +%Const,MakovaDrawTextCnts,KeyCodesCNTs +Default +%Library.TMEdit + + +%Library.String + + + +Args:%String +cache +0 +document +literal + + + + + +
  • csAlpha: Matches any of the 52 ASCII upper- and lower-case alphabetic characters (that is, A through Z and a through z) +
  • csLowerCase: Matches any of the 26 ASCII lower-case alphabetic characters (that is, a through z," "). +
  • csLowerCaseAC: Matches any of the 26 ASCII lower-case alphabetic characters (that is, a through z," "), autoconvert uppercases. +
  • csUpperCase: Matches any of the 26 ASCII upper-case alphabetic characters (that is, A through Z," "). +
  • csUpperCaseAC: Matches any of the 26 ASCII upper-case alphabetic characters (that is, A through Z," "), autoconvert lowercases.. +
  • csAll: Matches any of the characters in the printable ASCII character set (ASCII codes 0 through 255). +
  • csInteger: Matches any of the 10 ASCII numeric characters (that is, 0 through 9). +
  • csFloat: Matches any of the 10 ASCII numeric characters (that is, 0 through 9)+ CommaDelimiter (default ".") (Set scale for number of digits). +
  • csUserDefined: Matches any of the ASCII characters specified in UserDefinedCharSet + + +PS: Property "RawAllowedCharSet" can be used for TAB, ... +]]> +%Library.String +"csAll" + + + + +%Library.String +$$$clWhite + + + +%Library.String +$$$clBlack + + + +%Library.String +"." + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String +$$$clRed + + + +%Library.String +$$$clYellow + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.Integer +0 + + + + +Indien leeg: geen MaxValue +%Library.String + + + +%Library.Integer +0 + + + +%Library.String +"?" + + + +%Library.String +200 + + + +%Library.Integer +0 + + + +%Library.String + + + +%Library.String + + + + +Default: Tab (8) + +%Library.String +$C(8,9,10,13,27) + + + +%Library.Integer +0 + + + +%Library.Boolean +1 + + + +%Library.String + + + + +%Library.String + + + + +For internal use. + +generator +initvalue:%String +0 +%Library.Status + + + + +Value:%String +0 +%Library.Status + + + + +Value:%String +0 + + + + +Value:%String +0 +%Library.Status + + + + +0 + + + + +Args:%String +0 +..Scale Do + .. Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Cijferbeperking","Het aantal cijfers achter de komma is beperkt tot "_ ..Scale _" voor het veld '" _ ..CoupledProperty _ "'.")) + .. Do ..SetFocus() + .. Set ..SelStart=$Find(Value,..CommaDelimiter) //Overbodige digits selecteren, de gebruiker hoeft enkel DEL in te drukken + .. Set ..SelLength=DotLength + .. Set Error=1 + + //MaxValue + If ..MaxValue'="" If Value>..MaxValue Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Maximum waarde","De maximum waarde van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxValue _" karakter(s).")) + . Do ..ReFocusAndSelect() + . Set Error=1 + + //MinLen + If ..MinLen If $L(Value)<..MinLen Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Minimum lengte","De minimum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MinLen _" karakter(s).")) + . Do ..ReFocusAndSelect() + . Set Error=1 + + //MaxLen + If ..MaxLen If $L(Value)>..MaxLen Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Maximum lengte","De maximum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxLen _" karakter(s).")) + . Do ..SetFocus() + . Set ..SelStart=..MaxLen //Overbodige tekens selecteren, de gebruiker hoeft enkel DEL in te drukken + . Set ..SelLength=$L(Value)-..MaxLen + . Set Error=1 + + //Data - aware + If (..FOldValue'=Value) && 'Error Do //Geen fout, eventueel gekoppeld object bijwerken + . If (..FCoupledORef'=$$$NULLOREF) && (..CoupledProperty'="") Do + .. Do ..FAssignValue(Value) + + Set ..FOldValue=Value + + ;End of user code + s Args=$lb(Sender) + q + +]]> + + + +Args:%String +0 +64) && ($ASCII(Key)<91) Do + .. Set Key=$C($ASCII(Key)+32) + . Else If Key'?1(1L,1" ") Set InSet=0 + Else If ..AllowedCharSet="csUpperCase" Set:(Key'?1(1U,1" ")) InSet=0 //csUpperCase + Else If ..AllowedCharSet="csUpperCaseAC" Do //csUpperCaseAC + . If ($ASCII(Key)>96) && ($ASCII(Key)<123) Do + .. Set Key=$C($ASCII(Key)-32) + . Else If Key'?1(1U,1" ") Set InSet=0 + Else If ..AllowedCharSet="csAll" Set:(Key'?1E) InSet=0 //csAll + Else If ..AllowedCharSet="csInteger" Set:(Key'?1N) InSet=0 //csNumeric + Else If ..AllowedCharSet="csFloat" Do //csFloatNumeric + . If (Key'=..CommaDelimiter) Set:(Key'?1N) InSet=0 //Geen komma, set error wanneer ook geen cijfer + . Else Do + .. Set:($F(..Text,..CommaDelimiter)'=0) InSet=0 //Wel komma, geen error wanneer er nog geen komma in voorkomt + .. Set:(..Text="") InSet=0 //Wel komma, echter nog geen getallen ervoor + Else If ..AllowedCharSet="csUserDefined" Set:(..UserDefinedCharSet'[Key) InSet=0 //csUserDefined + + //Key in NavigatieSet of CharSet? Zoniet, negeer key dr gebruiker ingetoetst + If 'InRaw && 'InSet Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Keyboard input","De ingedrukte toets '" _ Key _ "' is niet geldig.")) + . Set Key=$C(0) + + ;End of user code + s Args=$lb(Sender,Key) + q + +]]> + + + + +Triggers just about nothing + +Value:%String +0 + + + + +0 + + + + + +Method for setting 'Text' property. + +Value:%String +0 +%Library.Status +..Scale Do + .. Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Cijferbeperking","Het aantal cijfers achter de komma is beperkt tot "_ ..Scale _" voor het veld '" _ ..CoupledProperty _ "'. De oorspronkelijke inhoud was '" _ Value _ "'.")) + .. Set Value=$E(Value,$Find(Value,..CommaDelimiter)+..Scale,99999) + + //MaxValue + If ..MaxValue'="" If Value>..MaxValue Do + . Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Maximum waarde","De maximum waarde van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxValue _" karakter(s). De oorspronkelijke inhoud was '" _ Value _ "'.")) + . Set Value=..MaxValue + + //MinLen + If ..MinLen If $L(Value)<..MinLen Do + . Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Minimum lengte","De minimum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MinLen _" karakter(s). De oorspronkelijke inhoud was '" _ Value _ "'.")) + . New Loop,Min,Start + . Set Min=..MinLen,Start=$L(Value)+1 + . For Loop=Start:1:Min Set $E(Value,Loop)=..MinLenFillChar + + //MinLen + If ..MaxLen If $L(Value)>..MaxLen Do + . Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Maximum lengte","De maximum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxLen _" karakter(s). De oorspronkelijke inhoud was '" _ Value _ "'.")) + . Set Value=$E(Value,1,..MaxLen) + + Do %this.SetProperty("Text",Value) + + q $$$OK + + + + +]]> + + + +Args:%String +0 + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +AutoSelect + + +BorderStyle + + +CanUndo + + +CharCase + + +HideSelection + + +MaxLength + + +Modified + + +OEMConvert + + +OnChange + + +PasswordChar + + +ReadOnly + + +SelLength + + +SelStart + + +SelText + + +PropName + + +CoupledORef + + +CoupledProperty + + +OnMessage + + +AllowedCharSet + + +UserDefinedCharSet + + +AllowedNavigationSet + + +CommaDelimiter + + +CoupledClassName + + +FCoupledORef + + +MaxLen + + +MinLen + + +MinLenFillChar + + +RawAllowedCharSet + + +FOldValue + + +Scale + + +Pattern + + +DisplayList + + +ValueList + + +BaseColor + + +ErrorColor + + +BaseFontColor + + +ErrorFontColor + + +LastMO + + +FMsgPaintBox + + +ShowMessages + + +FMsgIcon + + +FMsgPanel + + +FMsgCopy + + +MsgHint + + +MinimumHintWidth + + +MaxValue + + +FRealValue + + + + + Index: UI/Lib/Ctrl/TDAEdit5.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TDAEdit5.cls.xml (revision 0) +++ UI/Lib/Ctrl/TDAEdit5.cls.xml (revision 61) @@ -0,0 +1,27 @@ + + + +serial +Default +UI.Lib.Ctrl.TEdit5 + + +ORef,Property:%Library.String +cache +0 +%Library.Boolean +document +literal + + + + +%Library.CacheSerialState + + + Index: UI/Lib/Ctrl/TRadioGroup.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TRadioGroup.cls.xml (revision 0) +++ UI/Lib/Ctrl/TRadioGroup.cls.xml (revision 61) @@ -0,0 +1,414 @@ + + + +serial +%Const,KeyCodesCNTs,UILibCtrlCNTs +%Library.TMRadioGroup + + + +Contains oref of the %TMString object containing list of radio buttons names. + +%VHSys.Lib.TMStrings + + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnAfterFillItems=$lb(%this,"cboExampleOnAfterFillItems")
    +]]>     +%Library.String +     + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnBeforeFillItems=$lb(%this,"cboExampleOnBeforeFillItems")
    +]]>     +%Library.String +     + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + + +Wist alle Items (keys en text) in de ComboBox. + +cache +0 +document +literal + + + + + +Kopieert alle Items van één TRadioGroup (FromRadioG) naar deze TRadioGroup. Als de parameter SetSelected=1, dan wordt ook het geselecteerde item van FromRadioG overgenomen + +FromRadioG:UI.Lib.Ctrl.TRadioGroup,SetSelected:%Boolean=0 +cache +0 +document +literal + + + + +Event:%String,Args:%String="" +cache +0 +document +literal + + + + + ResetItem )
    +Verdere uitleg: zie method SetTextItems() van de klasse +VHSys.Lib.TMStrings
    +]]>     +Text:%String,Keys:%List,ResetItem:%Integer,CheckFlags:%Integer,RemoveFlags:%Integer +cache +0 +%Library.String +document +literal + +     + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Index:%Integer +cache +0 +document +literal + + + + +Key:%String +cache +0 +document +literal + + + + +Text:%String +cache +0 +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + + +SetIndex() is 100% gelijk aan SelectByIndex() + +Index:%Integer +cache +0 +document +literal + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +Items + + +OnAfterFillItems + + +OnBeforeFillItems + + +Items2 + + + +     +     Index: UI/Lib/Dlg/TPickLevFromList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickLevFromList.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickLevFromList.cls.xml (revision 61) @@ -0,0 +1,511 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +LookUpStr:%String +0 +%Library.Integer +0 + + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 +0 Do + .. Do ..lbLeveranciers.SetFocus() + .. Set ..lbLeveranciers.ItemIndex=0 + . Else Do + .. Do ..txtNaamNummer.SelectAll() + + ;End of user code + s Args=$lb(Sender,Key,Shift) + q + +]]> + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +lbSortList + + +lbKlanten + + +Bevel2 + + +Label1 + + +txtNaamNummer + + +lbLeveranciers + + + + + Index: UI/Lib/Ctrl/TWebBrowser.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TWebBrowser.cls.xml (revision 0) +++ UI/Lib/Ctrl/TWebBrowser.cls.xml (revision 61) @@ -0,0 +1,642 @@ + + + +0 +0 +serial +0 +%Const,TWebBrowserCNTs +0 +Default +%TMOleContainer +0 + + + +Query to see if something is still in progress. +%Library.String +0 +0 + +0 +1 +0 +0 +0 + + + +%Library.String +0 +0 + +0 +0 +0 +0 +0 + + + + +For internal use. +%Library.TMOleObject +0 +0 + +0 +0 +0 +0 +0 + + + + +Gets the short (UI-friendly) name of the URL/file currently viewed. +%Library.String +0 +0 + +0 +1 +0 +0 +0 + + + + +Gets the full URL/path currently viewed. +%Library.String +0 +0 + +0 +1 +0 +0 +0 + + + + +For internal use. + +0 +0 +generator +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code + +0 +0 + + + + + +Navigates to the previous item in the history list. +0 +0 +code + +0 +0 + + + + + +Navigates to the next item in the history list. +0 +0 +code + +0 +0 + + + + + +Go home/start page. +0 +0 +code + +0 +0 + + + + + +Go Search Page. +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +%Library.String +0 + + + + +0 +0 +code + +0 +%Library.String +0 + + + + +
    + +
  • +URL (required)
    +A String expression that evaluates to the URL, full path, or Universal Naming Convention (UNC) location and name of the resource to display. +
    • + +
  • +Flags (optional)
    +A constant or value that specifies whether to add the resource to the history list, whether to read from or write to the cache, and whether to display the resource in a new window. The variable can be a combination of the values defined by the BrowserNavConstants enumeration. +
    • + +
  • +TargetFrameName (optional)
    +String expression that evaluates to the name of an HTML frame in URL to display in the browser window. The possible values for this parameter available +in TWebBrowserCNTs. Note: you can also use a window name as parameter, which refers to a named HTML frame. If no frame or window exists that matches the +specified target name, a new window is opened for the specified link. +
    • + +
  • +PostData (optional)
    +Data to send to the server during the HTTP POST transaction. For example, the POST transaction is used to send data gathered by an HTML form to a program or script. If this parameter does not specify any post data, the Navigate method issues an HTTP GET transaction. This parameter is ignored if URL is not an HTTPURL. +
    • + +
  • +Headers (optional)
    +A value that specifies additional HTTP headers to send to the server. These headers are added to the default Microsoft® Internet Explorer headers. The headers can specify things like the action required of the server, the type of data being passed to the server, or a status code. This parameter is ignored if URL is not an HTTP URL. +
    • ]]>     +0 +0 +code +URL:%String,Flags,TargetFrameName,PostData,Headers:%String +0 +0 + + + + + +Refresh the currently viewed page. +0 +0 +code + +0 +0 + + + + + +Stops opening a file. +0 +0 +code + +0 +0 + + + + +%Library.CacheSerialState + +listnode + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +AllowActiveDoc + + +AllowInPlace + + +AutoActivate + + +AutoVerbMenu + + +BLOB + + +BorderStyle + + +CanPaste + + +CopyOnSave + + +Iconic + + +Linked + + +Modified + + +NewInserted + + +ObjectVerbs + + +OldStreamFormat + + +OleClassName + + +OnActivate + + +OnDeactivate + + +OnObjectMove + + +PrimaryVerb + + +SizeMode + + +SourceDoc + + +State + + +PropName + + +ShellObj + + +Busy + + +LocationName + + +LocationURL + + +FShellObj + + +Document + + + +     +     Index: UI/Lib/Ctrl/TTreeViewEx2.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TTreeViewEx2.cls.xml (revision 0) +++ UI/Lib/Ctrl/TTreeViewEx2.cls.xml (revision 61) @@ -0,0 +1,3117 @@ + + + +serial +KeyCodesCNTs,TTreeViewExCNTs,%Const +Default +%Library.TMTreeView +0 + + +%Library.Boolean +1 + + + +%Library.String + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%Library.TMTimer + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.String + + + +%Library.Integer +0 + + + +%Library.String + + + +%Library.String + + + +%Library.Integer +0 + + + + +Bevat ORef van laatste node die werd aangeclickt. + +Let wel: + +- De ORef (node) is misschien in een later stadium verwijderd, toch zal FLastNodeClicked dezelfde waarde behouden +- De ORef bestaat misschien nog, maar in de tussentijd kan alles verwijderd zijn, heropgevuld, en andere node met +zelfde ORef zijn plaats hebben ingenomen. + +%Library.String +0 + + + +%Library.String +0 + + + +%Library.Integer +-1 + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String +0.05 + + + +%Library.Boolean +0 + + + +%Library.String + + + + +%Library.Integer +-1 + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + + +ARGS=Sender,Program,RowID,Column,VolgNr,Bookmark,Node,X,Y,Button,Shift + +%Library.String + + + + +ARGS=Sender,Program,RowID,Column,VolgNr,Bookmark,Node,X,Y,Button,Shift + +%Library.String + + + + +EVENT: + +ARGS=$LB(Sender,Program,RowID,Column,Bookmark,Node,AllowEdit) + +Sender=Treeview ORef +AllowEdit invullen naargelang wijzigingen toegelaten zijn of niet + +%Library.String + + + +%Library.String + + + + +EVENT + +Args=$LB(Sender,Program,RowID,Column,Bookmark,Node,NewVal,AllowChange) + +%Library.String + + + + +EVENT: + +ARGS=$LB(Sender,ParentNode,ParentBookmark) + +%Library.String + + + + +EVENT: + +ARGS=$LB(Sender,Program,FetchID) + +Array 'aFS' is gevuld met een fetchdefinition (FetchID), je kan +deze gegevens nu wijzigen naar eigen noden + +%Library.String + + + +%Library.String + + + + +EVENT: + +ARGS=$LB(Sender,Program,Definition,VolgNr) + +Array 'aLD' is gevuld met een listdefinition + +aLD(%this,0)=$LB(Program,FetchID) +aLD(%this,1)=$LB(Program,FetchID) +dus aLD(%this,VolgNr) + +Wijzigingen aanbrengen in de array is NIET aan te raden +en kan leiden tot onverwachte resultaten + +Interfacekoppeling: +iLD(%this,Node.Level)=VolgNr + +%Library.String + + + + +EVENT: + +ARGS=$LB(Sender,Program,RowID,IsHeader) + +Array 'aLS' is gevuld met een listdefinition (RowID), je kan +deze gegevens nu wijzigen naar eigen noden +Array 'SortedCols' bevat: +SortedCols(1)=column1 +SortedCols(2)=column2 enz... + +%Library.String + + + +%Library.String + + + +%Library.Boolean +0 + + + +%Library.String +0 + + + +%Library.Boolean +1 + + + + +Unique Node + +Combinatie van: +$J _ %this _ "TV" + +Wordt gebruikt bij ^Hulp als uniek nodenummer + +Opbouw ^Hulp: + +^Hulp(..UN,TreeNodeORef,$$$ntFieldData)=$LB(...): bevat de "data" +^Hulp(..UN,TreeNodeORef,$$$ntHasChildren)=1 of 0, de node bevat 'children' +^Hulp(..UN,TreeNodeORef,$$$ntNodesFetched)=1 of 0, zijn de childnodes reeds gefetched of niet + +%Library.String +$J_+%this_"TV" + + + +%Library.Integer ++%this + + + + +For internal use. + +generator +initvalue:%String +0 +%Library.Status + + + + + ParentNode: Oref van de node waaraan deze moet worden toegevoegd ]]> +ParentNode:%TMTreeNode=0 +0 + + + + + ParentNode: Oref van de node waaraan deze moet worden toegevoegd +
  • HdrRowID: Dit HdrRowID gebruiken ipv default
    • +
  • Program: Dit Program gebruiken ipv default
    • ]]>     +ParentNode:%TMTreeNode=0,HdrRowID:%String,Program:%String +0 +%Library.TMTreeNode + +     + + + ParentNode: Oref van de node waaraan deze moet worden toegevoegd +
  • FieldData: $LB met daarin alle veldinhoud (bijv. 3 velden naam,adres,leeftijd: FieldData=$LB("Fons","Krekelstraat",46)
    • +
  • Bookmark: Data die moet gekoppeld worden aan de row (bijv. ID's, ORefs, ...)
    • +
  • HasChildren: Bij gebruik van OnFetchNodes beslissen of de toe te voegen node kinderen heeft (tekent een '+') of niet
    • +
  • RowID: Dit RowID gebruiken ipv default
    • +
  • SelRowID: Dit SelRowID gebruiken ipv default
    • +
  • IsSelectable: Is de node selecteerbaar?
    • +
  • NodesFetched: Zijn de childnodes reeds gefetched of niet
    • +
  • Program: Dit Program gebruiken ipv default
    • ]]>     +ParentNode:%TMTreeNode=0,FieldData,Bookmark:%String,HasChildren:%Boolean,RowID,SelRowID:%String,IsSelectable:%Boolean=1,NodesFetched:%Boolean=0,Program:%String +0 +%Library.TMTreeNode + +     + + + +Zwier alles uit de bmpbuffer zodat hertekenen van de rows vereist is (enkel text-redraw). +0 +%Library.Boolean + + + + + +Roep dit op ipv %TMTreeView.Items.Clear(). +0 + + + + + +Afsluiten ingelezen programma. +0 +- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program worden ingelezen, er kan + ; eventueel een event gekoppeld worden om zaken voor te bereiden + New StdArgs + Set StdArgs=$LB(%this,..Program,"True") ;ARGS: $LB(Sender,Program,DefaultClose) + Do ..FTriggerEvent(..OnBeforeCloseProgram,.StdArgs) + If $LI(StdArgs,3)="False" Do Quit 1 ;Nog CloseProgram oproepen, dan sluiten + . Do ..FTriggerEvent(..OnAfterCloseProgram,$LB(%this,..Program,"False")) + ;============================================================================= + + ;Validering van een nog eventueel actief veld + ;Geen focus op tree daarna, aangezien CloseProgram met de treeview 'off screen' kan gebeuren + Do ..FValidateField(0) + + ;Arrays met definities + Do ..FUnPrepareGP() + Do ..FUnPrepareLDs() + Do ..FUnPrepareFSs() + Do ..FUnPrepareLSs() + + ;Array met fast index access (via Node.Level) + Do ..FUnPrepareLDInterfaceIndex() + + ;Array met verwijzingen naar (+) en (-) buttons + Do ..FReleaseBTNs() + + ;In de loop van de treeview zijn ook icons aangemaakt (denk bijv. aan (+) & (-) btns) + Do ..FReleaseBlobIcons() + + ;Eventueel opgebouwde components de vrijheid geven + Do ..FReleaseComponents() + + ;Clear data: TreeNode objects, $$$ND + Do ..ClearData() + + ;Clear BMP Buffer + Do ..FReleaseBMPBuffer() + + ;Alles uit DQ halen + Do ..FClearDrawQueue() + + ;MaxBufferCount terug op 0 instellen + Set i%MaxBufferCount=0 ;Set-method mag niet getriggerd worden + + ;============================================================================= + ; -< EVENT 'OnAfterCloseProgram' >- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program werden gesloten, er kan + ; eventueel een event gekoppeld worden om zaken te herzien,... + ; ARGS: $LB(Sender,Program,DefaultClosed) + Do ..FTriggerEvent(..OnAfterCloseProgram,$LB(%this,..Program,"True")) + ;============================================================================= + + ;Programma(waarschijnlijk) goed opgekuisd + Set ..Program="" + Set ..ProgramIsLoaded=0 + + Quit +]]> + + + + +Roep dit op ipv %TMTreeNode.Delete(). +Node:%TMTreeNode +0 + + + + + BaseNode: Node to expand, indien 0 dan wordt alles ge-expand, indien niet opgegeven wordt geselecteerde node genomen +
  • Level: Expanden tot en met niveau 'Level', indien niet opgegeven wordt ge-expand tot het diepste niveau
    • +
  • MaxLevel: Normaliter wordt dit uit iLD gehaald, is deze array echter dynamisch opgebouwd (+gebruik van onfetchnodes) dan kan u hier het maximum opgeven
    • ]]>     +BaseNode:%TMTreeNode,ToLevel,MaxLevel:%Integer +0 +MaxLevel Set ToLevel=MaxLevel + + ;Expanderen maar... + Do ..Items.BeginUpdate() + If +BaseNode=0 Do ;EXPAND FULL + . New tmpNode + . Set tmpNode=..Items.GetFirstNode() + . Quit:(+tmpNode=0) + . Do RecurseExp(tmpNode) + . For Set tmpNode=tmpNode.GetNextSibling() Quit:(+tmpNode=0) Do + .. Do RecurseExp(tmpNode) + Else Do ;EXPAND FROM BASENODE + . Do RecurseExp(BaseNode) + + Do ..Items.EndUpdate() + + Quit + +RecurseExp(Base) + Quit:(Base.Level=ToLevel) + + If $$$NDE(Base,$$$ntNodesFetched) && (Base.HasChildren="True") Do + . Do Base.Expand("False") + Else If $$$NDE(Base,$$$ntHasChildren) Do + . Do ..FFirstExpand(Base) + Else Quit + + New tmpChild + Set tmpChild=Base.GetFirstChild() + Quit:(tmpChild="") + + Do RecurseExp(tmpChild) + For Set tmpChild=tmpChild.GetNextSibling() Quit:(tmpChild="") Do + . Do RecurseExp(tmpChild) + + Quit +]]> +     + + + For internal use only:
    +Voeg de opgegeven BMP toe aan de buffer. Geef op aan welke node deze BMP gekoppeld is.]]>     +BMPToBuffer:%TMBitmap,Node:%TMTreeNode +0 +%Library.TMBitmap +..MaxBufferCount Do + . Set BufferPosition=1 + + ;Bufferposition onthouden + Set pcBMPPool(..aUN)=BufferPosition + + ;Bitmapspecs kopiëren + Set BmpInBuffer.Width=BMPToBuffer.Width + Set BmpInBuffer.Height=BMPToBuffer.Height + Set BmpInBuffer.PixelFormat=BMPToBuffer.PixelFormat + + ;Bitmap zelf kopiëren + Do BmpInBuffer.Canvas.Draw(0,0,BMPToBuffer) + + Quit BmpInBuffer +]]> +     + + + For internal use only:
    +OnExit event van treeview components (edit, combo, memo, ...)]]>     +Args:%String +0 + +     + + + For internal use only:
    +OnKeyDown event van treeview components (edit, combo, memo, ...)]]>     +Args:%String +0 + +     + + + For internal use only:
    +Tekenen van BMP (gedefinieerd via Program en RowID). U kan een BMP opgegeven om te gebruiken of één laten aanmaken (bij VBitmap=0) +Het resultaat van de functie is de getekende bitmap.]]>     +VBitmap:%Library.TMBitmap,Program:%Library.String,RowID:%Library.String +0 +%Library.TMBitmap + +     + + + For internal use only:
    +Wat er eventueel nog in de DrawQueue staat wordt hiermede verwijderd.]]>     +0 + +     + + + For internal use only:
    +Kopiëren van BMP-specs, zijnde PixelFormat,Width,Height. +Indien VBitmap=0 dan wordt een nieuwe BMP aangamaakt, indien +niet dan wordt de vorige inhoud gewist (FillRect).]]>     +VBitmap,BmpToCopy:%TMBitmap +0 +%Library.TMBitmap + +     + + + For internal use only:
    +Tekent tekst op bitmap. RawData bevat $LB met inhoud van de velden.]]>     +Bitmap:%TMBitmap,Program,RowID,RawData,DefRow:%String +0 + +     + + + For internal use only:
    +Tekent headertekst op bitmap.]]>     +Bitmap:%TMBitmap,Program,RowID:%String +0 + +     + + + For internal use only:
    +Prepare for edit.]]>     +Program,RowID,Column:%String,Node:%TMTreeNode +0 + +     + + + For internal use only:
    +Forceer een eerste expand. Indien uw tree gebruikt maakt van OnFetchNodes en u wenst programmatorisch een +fetch te doen, dan kan dat via FFirstExpand. Een node waarbij de children reeds zijn aangemaakt kan eenvoudigweg +opgeklapt worden via %TMTreeNode.Expand().]]>     +NodeToExpand:%TMTreeNode,DoExpand:%Boolean=1 +0 + +     + + + For internal use only:
    +Verwerk de gegevens die op de DrawQueue staan. Dwz alle nodes die in de huidige viewspace liggen worden getekend.]]>     +0 +..FDisplayY2) Do ;Teken enkel de items binnen de huidige canvas + .. Do DrawItem(SMORefNode,.X1,.Y1,.Y2) + + ;Queue klaarstomen om opnieuw te vullen + Do ..FClearDrawQueue() + + Quit + + ;============================================================================== +DrawItem(Node,X1,Y1,Y2) + New Selected + Set Selected=$S(Node.Selected="True":1,1:0) + + ;BMP BUFFER CHECK - IF AVAILABLE: Use and quit + If $D(pcBMP(..aUN,+Node)) && ('Selected) Do Quit + . If Selected Do + .. Do ..Canvas.Draw(X1+$$$NDE(Node,$$$ntSelBSpaceLeft),Y1+$$$NDE(Node,$$$ntSelBSpaceTop),pcBMP(..aUN,+Node)) + . Else Do + .. Do ..Canvas.Draw(X1+$$$NDE(Node,$$$ntBSpaceLeft),Y1+$$$NDE(Node,$$$ntBSpaceTop),pcBMP(..aUN,+Node)) + . If '$$$NDE(Node,$$$ntIsHeader) Do + .. If $$$NDE(Node,$$$ntHasChildren) Do + ... If Node.Expanded="True" Do + .... Set ..Canvas.Brush.Color=..Color + .... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + .... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inCollapseBtn)) + ... Else Do + .... Set ..Canvas.Brush.Color=..Color + .... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + .... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inExpandBtn)) + + If Node.Level'=..FLastNodeLevel Do + . Set ..FCachedProgram=$G(iLD(..aUN,Node.Level,$$$ildProgram),$$$NDE(Node,$$$ntProgram)) + + New BmpToUse + If $$$NDE(Node,$$$ntIsHeader) Do ; *** HEADER *** + . Set BmpToUse=$$$NDE(Node,$$$ntVBackground) + . Do ..FAddToBMPBuffer(BmpToUse,Node) + . Do ..Canvas.Draw(X1+$$$NDE(Node,$$$ntBSpaceLeft),Y1+$$$NDE(Node,$$$ntBSpaceTop),BmpToUse) + Else If Selected Do ; *** SELECTED *** + . Set BmpToUse=$$$NDE(Node,$$$ntSelVFlip) + . Do BmpToUse.Canvas.Draw(0,0,$$$NDE(Node,$$$ntSelVBackground)) + . If $$$NDE(Node,$$$ntHasChildren) Do + .. If Node.Expanded="True" Do + ... Set ..Canvas.Brush.Color=..Color + ... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + ... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inSelCollapseBtn)) + .. Else Do + ... Set ..Canvas.Brush.Color=..Color + ... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + ... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inSelExpandBtn)) + . Do ..FDrawTextOnRow(BmpToUse,..FCachedProgram,$$$NDE(Node,$$$ntSelRowID),$$$NDE(Node,$$$ntFieldData),$$$NDE(Node,$$$ntRowID)) + . Do ..Canvas.Draw(X1+$$$NDE(Node,$$$ntSelBSpaceLeft),Y1+$$$NDE(Node,$$$ntSelBSpaceTop),BmpToUse) + Else Do ; *** NORMAL (default) *** + . Set BmpToUse=$$$NDE(Node,$$$ntVFlip) + . Do BmpToUse.Canvas.Draw(0,0,$$$NDE(Node,$$$ntVBackground)) + . If $$$NDE(Node,$$$ntHasChildren) Do + .. If Node.Expanded="True" Do + ... Set ..Canvas.Brush.Color=..Color + ... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + ... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inCollapseBtn)) + .. Else Do + ... Set ..Canvas.Brush.Color=..Color + ... Do ..Canvas.FillRect($LB(X1-17,Y1,X1,Y2)) + ... Do ..Canvas.Draw(X1-17,Y1+((Y2-Y1-13)\2),aBTN(..aUN,Node.Level,$$$inExpandBtn)) + . Do ..FDrawTextOnRow(BmpToUse,..FCachedProgram,$$$NDE(Node,$$$ntRowID),$$$NDE(Node,$$$ntFieldData),$$$NDE(Node,$$$ntRowID)) + . Do ..FAddToBMPBuffer(BmpToUse,Node) + . Do ..Canvas.Draw(X1+$$$NDE(Node,$$$ntBSpaceLeft),Y1+$$$NDE(Node,$$$ntBSpaceTop),BmpToUse) + + Quit +]]> +     + + + For internal use only:
    +Called by FCacheVirtualRow()]]>     +Bitmap:%TMBitmap,Program,RowID:%String +0 + +     + + + For internal use only:
    +Maakt bitmaps aan die gebruikt worden voor buffering van treenodes. Aantal wordt bepaald door +Program-definitie.]]>     +0 +%Library.Boolean +..MaxBufferCount Do Quit 0 + . Set ..LastErrorMsg="Fout bij inladen buffer: PreBufferCount("_PreBufferCount_") is groter dan MaxBufferCount("_..MaxBufferCount_")." + + ;IF PREBUFFERCNT=-1: MAXIMUM BUFFERING + If PreBufferCount=-1 Do + . Set PreBufferCount=..MaxBufferCount + + ;BUFFER (AANMAKEN 1->PREBUFFERCOUNT) + New Loop,tmpBitmap + For Loop=1:1:PreBufferCount Do + . Set pcBMPPool(..aUN,Loop)=##class(%TMBitmap).%New($LB(..Parent,0)) + . Set pcBMPPool(..aUN,Loop,$$$pcAssocNode)=0 ;Nog geen gekoppelde node... + + ;COUNT INITIALISEREN + Set pcBMPPool(..aUN)=1 + + Quit 1 +]]> +     + + + For internal use only:
    +Buttons (voorgesteld via Icons) voor '+' en '-' van de treenodes. Gedefinieerd in Program-definitie. ]]>     +0 +%Library.Boolean + +     + + + For internal use only:
    +Lees een BlobIcon in. Deze kan verderop hergebruikt worden adhv BlobName. Alles wordt +dus maw 1 maal ingelezen.]]>     +BlobName:%String +0 +%Library.TMIcon + +     + + + For internal use only:
    +Creatie van component indien het nog niet bestaat. Result is ORef van component.]]>     +ComponentType:%Integer +0 +%Library.Integer + +     + + +Program,FetchID:%String +0 +%Library.Boolean + + + + +0 +%Library.Boolean + + + + +Program:%String +0 +%Library.Boolean + + + + +Program,DefinitionID:%String +0 +%Library.Boolean + + + + +0 +%Library.Boolean + + + + +Program:%String +0 +%Library.Boolean + + + + +Program,RowID:%String,IsHeader:%Boolean=0 +0 +%Library.Boolean + + + + +0 +%Library.Boolean + + + + +Program,RowID:%String,IsHeader:%Boolean=0 +0 +%Library.Boolean +0 Do + .. Set SortedCols(Loop)=ColLoop + + ;Checken of volgnummers legaal zijn + New VolgNrLoop,EarlyQuit + Set EarlyQuit=0 + For VolgNrLoop=1:1:AantalCols Quit:(EarlyQuit) Do + . If '$D(CheckVolgNrs(VolgNrLoop)) Do + .. Set ..LastErrorMsg="In de lijst-definitie van '"_RowID_"' uit het programma '"_Program_"' is een fout volgnummer gevonden." + . Else If CheckVolgNrs(VolgNrLoop)>1 Do + .. Set ..LastErrorMsg="In de lijst-definitie van '"_RowID_"' uit het programma '"_Program_"' komt het volgnummer '"_VolgNrLoop_"' meermaals voor." + Quit:(EarlyQuit) 0 + + ;Column Specs herinlezen om posities te bepalen (start-end-fulllength): eventueel gewijzigd na vorig event + New tmpLength,XOffs,sumLength,SortLoop + Set SortLoop="" + Set sumLength=$LI(aLS(..aUN,Program,RowID),$$$rcLinkerlijnDikte) + Set XOffs=sumLength-1 ;-1 omdat we beginnen van (0,0) + For Set SortLoop=$O(SortedCols(SortLoop)) Quit:(SortLoop="") Do + . Set ColLoop=SortedCols(SortLoop) + . ;Lengte van huidige column uitlezen + . Set tmpLength=aLS(..aUN,Program,RowID,ColLoop,$$$ccLength) + . ;Instellen van begin-end waarden aparte velden + . Set XOffs=XOffs+1 ;+1 omdat we op een volgende pixellijn beginnen met de column + . Set aLS(..aUN,Program,RowID,ColLoop,$$$ccRTXBegin)=XOffs + . Set XOffs=XOffs+tmpLength-1 ;Lengte van column opschuiven + . Set aLS(..aUN,Program,RowID,ColLoop,$$$ccRTXEnd)=XOffs + . Set XOffs=XOffs+aLS(..aUN,Program,RowID,ColLoop,$$$ccRechterlijnDikte) ;Lengte van rechterlijn opschuiven + . ;Optellen 'Total Length' + . Set sumLength=sumLength+tmpLength+aLS(..aUN,Program,RowID,ColLoop,$$$ccRechterlijnDikte) + + ;Bijvoegen van 'op voorhand berekende waarde': + ;full-length van de frame (row) + Set $LI(aLS(..aUN,Program,RowID),$$$rcRTLength)=sumLength + ;IsHeader parameter (wo gebruikt bij RePrepareLS) + Set $LI(aLS(..aUN,Program,RowID),$$$rcRTIsHeader)=IsHeader + + ;Eventuele Bitmap cachen + New VBitmap + ;Set VBitmap=$LG(aLS(..aUN,Program,RowID),$$$rcRTVBackground,0) + ;Set VBitmap=..FCacheVirtualRow(VBitmap,Program,RowID) + Set VBitmap=..FCacheVirtualRow(0,Program,RowID) + Set $LI(aLS(..aUN,Program,RowID),$$$rcRTVBackground)=VBitmap + + ;Onthouden of het een header is of niet voor een eventuele RePrepareLS + Set $LI(aLS(..aUN,Program,RowID),$$$rcRTIsHeader)=IsHeader + + ;Kopie maken (enkel specs), deze bitmap wo gebruikt als 'flipscreen' + New VBitmap + ;Set VBitmap=$LG(aLS(..aUN,Program,RowID),$$$rcRTVFlip,0) + ;Set VBitmap=..FCopyBitmapSpecs(VBitmap,$LI(aLS(..aUN,Program,RowID),$$$rcRTVBackground)) + Set VBitmap=..FCopyBitmapSpecs(0,$LI(aLS(..aUN,Program,RowID),$$$rcRTVBackground)) + Set $LI(aLS(..aUN,Program,RowID),$$$rcRTVFlip)=VBitmap + + Quit 1 +]]> + + + +0 +%Library.Boolean + + + + +0 + + + + +0 + + + + +0 + + + + +0 + + + + +Node:%TMTreeNode +0 + + + + +Event:%String,Args:%String="" +0 + + + + +0 + + + + +0 + + + + +0 + + + + +0 + + + + +Program,RowID:%String +0 + + + + +0 + + + + +0 + + + + +FocusTreeWhenDone:%Boolean=1 +0 + + + + +Node:%TMTreeNode +0 +%Library.String + + + + +Column:%String,Node:%TMTreeNode +0 +%Library.String + + + + +Column:%String,Node:%TMTreeNode +0 +%Library.Integer + + + + +Level:%Integer +0 +%Library.String + + + + +Level:%Integer +0 +%Library.String + + + + +Level:%Integer +0 +%Library.String + + + + +Node:%TMTreeNode +0 +%Library.String + + + + +Node:%TMTreeNode +0 +%Library.String + + + + +Level:%Integer +0 +%Library.String + + + + +Node:%TMTreeNode +0 +%Library.String + + + + +InsBeforeNode:%TMTreeNode=0 +0 + + + + +InsBeforeNode:%TMTreeNode=0,FieldData,Bookmark:%String,HasChildren:%Boolean,RowID,SelRowID:%String,IsSelectable:%Boolean=1,NodesFetched:%Boolean=0 +0 +%Library.TMTreeNode + + + + +Value:%String +0 +%Library.Status + + + + +Program:%String +0 +%Library.Boolean +- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program worden ingelezen, er kan + ; eventueel een event gekoppeld worden om zaken voor te bereiden + New StdArgs + Set StdArgs=$LB(%this,Program,0,"True") ;ARGS: $LB(Sender,Program,IsReload,DefaultLoad) + Do ..FTriggerEvent(..OnBeforeLoadProgram,.StdArgs) + If $LI(StdArgs,4)="False" Do Quit 1 ;Nog LoadProgram oproepen, dan sluiten + . Do ..FTriggerEvent(..OnAfterLoadProgram,$LB(%this,Program,0,"False")) + ;============================================================================= + + ;Geen Drawing-update laten gebeuren (in principe overbodig aangezien er toch geen + ;elementen zich in de treeview bevinden) + Do ..Items.BeginUpdate() + + ;General variables + New PrepareOK + + ;GENERAL PROPERTIES: GP + Set PrepareOK=..FPrepareGP(Program) + Quit:('PrepareOK) 0 + + ;LIST DEFINITIONS: LD + Set PrepareOK=..FPrepareLDs(Program) + Quit:('PrepareOK) 0 + + ;FETCH DEFINITIONS: FD + Set PrepareOK=..FPrepareFSs() + Quit:('PrepareOK) 0 + + ;LIST STRUCTURES: Deze worden pas ingelezen van zodra ze vereist zijn indien LoadDefaultRows=0 + If $LI(aGP(..aUN),$$$gcLoadDefaultRows) Do Quit:('PrepareOK) 0 + . Set PrepareOK=..FPrepareLSs() + + ;LIST DEFINITION INTERFACE INDEX - FAST LOOKUP TABLE + Set PrepareOK=..FPrepareLDInterfaceIndex() + Quit:('PrepareOK) 0 + + New LoadOK + Set LoadOK=1 + ;BUTTONS (+) & (-) voor gewoon en selected + If $LI(aGP(..aUN),$$$gcLoadDefaultRows) Do Quit:('LoadOK) 0 + . Set LoadOK=..FLoadBTNs() + + ;BMP BUFFER - Graphical caching van nodes + Set LoadOK=..FLoadBMPBuffer() + Quit:('LoadOK) 0 + + ;Drawing-update kan terug van start gaan + Do ..Items.EndUpdate() + + ;============================================================================= + ; -< EVENT 'OnAfterLoadProgram' >- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program werden ingelezen, er kan + ; eventueel een event gekoppeld worden om zaken te herzien,... + ; ARGS: $LB(Sender,Program,IsReload,DefaultLoaded) + Do ..FTriggerEvent(..OnAfterLoadProgram,$LB(%this,Program,0,"True")) + ;============================================================================= + + ;Programma(waarschijnlijk) goed ingelezen + Set ..Program=Program + Set ..ProgramIsLoaded=1 + + Quit 1 +]]> + + + +Value:%Integer +0 +%Library.Status +..MaxBufferCount Do + . Set i%MaxBufferCount=Value + Else Do + . Set ..LastErrorMsg="Het is enkel toegestaan MaxBufferCount te vergroten (Huidig: "_..MaxBufferCount_", Voorstel: "_Value_")." + + Quit $$$OK +]]> + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + + +EVENT + +Wordt getriggerd bij tekenen van treeview. +U kan uw eigen ondrawevent koppelen op de +klassieke manier. Wilt u dan ook nog de originele +oproepen dan kan dat via 'OrigOnDrawItem' + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 +XBegin) && (X + + + +0 +%Library.Boolean +- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program worden ingelezen, er kan + ; eventueel een event gekoppeld worden om zaken voor te bereiden + New StdArgs + Set StdArgs=$LB(%this,Program,1,"True") ;ARGS: $LB(Sender,Program,IsReload,DefaultLoad) + Do ..FTriggerEvent(..OnBeforeLoadProgram,.StdArgs) + If $LI(StdArgs,4)="False" Do Quit 1 ;Nog LoadProgram oproepen, dan sluiten + . Do ..FTriggerEvent(..OnAfterLoadProgram,$LB(%this,Program,1,"False")) + ;============================================================================= + + Do ..Items.BeginUpdate() + + ;De eventueel gewijzigde aLS structure opnieuw inlezen-verwerken + New RePrepareOK + Set RePrepareOK=..FRePrepareLS() + Quit:('RePrepareOK) 0 + + ;Release van buttons niet echt vereist aangezien LD en FS nt veranderd zijn, maar toch + Do ..FReleaseBTNs() + ;In aLS stonden ook mogelijk nieuwe verwijzingen naar (+) en (-) buttons, cache deze + New LoadOK + Set LoadOK=..FLoadBTNs() + Quit:('LoadOK) 0 + + ;De oude, gebufferde nodes vrijgeven zodat nieuwe hun plaats kunnen innemen + Do ..ClearBMPBuffer() + + ;NodeData bevat verwijzingen nr oude Background & Flipbitmaps, deze dus ook updaten + Do ..FUpdateNodeData() + + Do ..Items.EndUpdate() + + ;============================================================================= + ; -< EVENT 'OnAfterLoadProgram' >- + ;============================================================================= + ; We verwittigen de buitenwereld dat Program werden ingelezen, er kan + ; eventueel een event gekoppeld worden om zaken te herzien,... + ; ARGS: $LB(Sender,Program,IsReload,DefaultLoaded) + Do ..FTriggerEvent(..OnAfterLoadProgram,$LB(%this,Program,1,"True")) + ;============================================================================= + + Quit 1 +]]> + + + +Nodes:%List="" +0 + + + + +FileName:%String,Levels:%List="",ColSep:%String=$C(9) +0 + + + + +Node:%TMTreeNode,Bookmark:%String +0 + + + + +Column:%String,Value:%String,Node:%TMTreeNode +0 + + + + +Node:%TMTreeNode,HasChildren:%Boolean +0 + + + + +Node:%TMTreeNode,IsSelectable:%Boolean +0 + + + + +NodeA,NodeB:%TMTreeNode +0 +%Library.Boolean + + + + +Canvas:%TMCanvas,Program,RowID,ColID:%String,Color:%Integer,FrameColor:%Integer=$$$clNone,Style:%String="bsSolid" +0 + + + + +Canvas:%TMCanvas,Program,RowID,ColID,BlobName:%String,Align:%String +0 + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +Canvas + + +DropTarget + + +Images + + +Items + + +OnChange + + +OnChanging + + +OnCollapsed + + +OnCollapsing + + +OnCompare + + +OnCustomDraw + + +OnCustomDrawItem + + +OnDeletion + + +OnEdited + + +OnEditing + + +OnExpanded + + +OnExpanding + + +OnGetImageIndex + + +OnGetSelectedIndex + + +OnAfterLoadProgram + + +OnBeforeLoadProgram + + +FProgram + + +LastErrorMsg + + +Program + + +ProgramLoaded + + +OnPrepareGS + + +MaxBufferCount + + +ProgramIsLoaded + + +OnAfterCloseProgram + + +OnBeforeCloseProgram + + +OnPrepareLD + + +AutoHourGlass + + +OnPrepareFS + + +OnPrepareLS + + +AutoShowLastErrorMsg + + +OnErrorMsg + + +UN + + +FCachedProgram + + +FDisplayY1 + + +FDisplayY2 + + +FFlushTimer + + +FForceFlush + + +FInhibitFlush + + +FLastBookmark + + +FLastCalledCMP + + +FLastColumn + + +FLastColumnClicked + + +FLastNode + + +FLastNodeClicked + + +FLastNodeDrawedTimeStamp + + +FLastNodeLevel + + +FLastProgram + + +FLastRowID + + +FLastValue + + +FMinFlushDelay + + +IgnoreNextFlushes + + +ReadOnlyTree + + +OnFetchNodes + + +OnClickField + + +OnDblClickField + + +OnEnterEdit + + +OnExitEdit + + +OnBeforeShowComponent + + +OnPrepareGP + + +RepaintOnFetchNodes + + +aUN + + + +     +     Index: UI/Lib/Dlg/ListDataPump.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/ListDataPump.cls.xml (revision 0) +++ UI/Lib/Dlg/ListDataPump.cls.xml (revision 61) @@ -0,0 +1,886 @@ + + + +serial +KeyCodesCNTs +Default +%Library.TMFormClass +0 + + +%TMBevel + + + +%Library.TMForm + + + +%Library.ListOfDataTypes + + + +%Library.Integer +0 + + + +%Library.String +0 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMListBox + + + +%TMListBox + + + +%TMEdit + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +%Library.Boolean +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Data:%String +cache +0 +%Library.Integer +document +literal + + + + +Data:%String +cache +0 +%Library.Integer +document +literal + + + + +cache +0 +%Library.ListOfDataTypes +document +literal + + + + +Del:%String +cache +0 +%Library.String +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + + +RemoveFromSource=True: +verwijder een element uit de source als het in de dest voorkomt + +Data:%ListOfDataTypes,RemoveFromSource:%Boolean="True" +cache +0 +document +literal + + + + +Data:%String,Del:%String,RemoveFromSource:%Boolean="False" +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal +(..lbDest.Items.Count-2)) //laatste uit lijst (kan niet down) + + Do ..lbDest.Items.Exchange(..lbDest.ItemIndex,..lbDest.ItemIndex+1) + Set ..lbDest.ItemIndex=..lbDest.ItemIndex+1 + + ;End of user code + s Args=$lb(Sender) + q +]]> + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + + +Address + + +Form + + +SpeedButton1 + + +SpeedButton2 + + +SpeedButton3 + + +SpeedButton4 + + +lbDest + + +lbSource + + +btnAllToDest + + +btnAllToSource + + +btnAnnuleren + + +btnDestDown + + +btnDestUp + + +btnOk + + +btnOneToDest + + +btnOneToSource + + +Bevel1 + + +MaxEntriesInDest + + +btnExtraToDest + + +txtExtraListEntry + + +FullSourceList + + +MinElementsInDest + + + + + Index: UI/Lib/Ctrl/TSortableListView.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TSortableListView.cls.xml (revision 0) +++ UI/Lib/Ctrl/TSortableListView.cls.xml (revision 61) @@ -0,0 +1,343 @@ + + + +serial +%Const +Default +%Library.TMListView + + +%Library.Integer +-1 + + + + +1: Ascending +-1: Descending + +%Library.Integer +1 + + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal +%Nr2:1,1:-1) + + If ..SortColumnIndex=-1 Do Quit + Else If ..SortColumnIndex=0 Do + . Set Compare=$$$CmpNr(Item1.Caption,Item2.Caption) + Else Do + . New Index + . Set Index=..SortColumnIndex-1 + . Set Compare=$$$CmpNr(Item1.SubItems.GetStrings(Index),Item2.SubItems.GetStrings(Index)) + + ;End of user code + s Args=$lb(Sender,Item1,Item2,Data,Compare) + q +]]> + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +Canvas + + +Columns + + +IconOptions + + +Items + + +OnChange + + +OnChanging + + +OnColumnClick + + +OnCompare + + +OnCustomDraw + + +OnCustomDrawItem + + +OnData + + +OnDataFind + + +OnDataHint + + +OnDeletion + + +OnDrawItem + + +OnEdited + + +OnEditing + + +OnGetImageIndex + + +OnSelectItem + + +Query + + +SortColumnIndex + + +SortDirection + + +IsNumber + + + + + Index: UI/Lib/Ctrl/TComboBox.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TComboBox.cls.xml (revision 0) +++ UI/Lib/Ctrl/TComboBox.cls.xml (revision 61) @@ -0,0 +1,884 @@ + + + + +Standaard events: +- OnChange >> #Orig +- OnEnter >> #Orig +- OnExit >> #Orig +- OnKeyDown >> #Orig +- OnKeyPress >> #Orig + +
    +Extra events:
+OnChangeItem  >>                       Args=$LB(Sender,PrevIndex)
+OnBeforeFillItems  >>  #Orig         Args=$LB(Sender)
+OnAfterFillItems >>  #Orig             Args=$LB(Sender)
+
    ]]>     +serial +%Const,KeyCodesCNTs,UILibCtrlCNTs +Default +%Library.TMComboBox + + +%Library.String +-1 + + + +%Library.String +1 + + + + +Collection of the drop-down list options. Use %TMString methods (Add, Insert, Move, Delete, IndexOf) to operate with separate items. +%VHSys.Lib.TMStrings + + + +%Library.String +"False" + + + +%Library.String +"False" + + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnAfterFillItems=$lb(%this,"cboExampleOnAfterFillItems")
    ]]>     +%Library.String +     + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnBeforeFillItems=$lb(%this,"cboExampleOnBeforeFillItems")
    ]]>     +%Library.String +     + + + +Geeft als argumenten terug: $LB(Sender,PrevIndex)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnChangeItem=$lb(%this,"cboExampleChangeItem")
    ]]>     +%Library.List +     + + + +For internal use. +generator +initvalue:%String +0 +%Library.Status + + + + + +Wist alle Items (keys en text) in de ComboBox. +0 + + + + + +Kopieert alle Items van één TComboBox (FromCombo) naar deze TComboBox. Als de parameter SetSelected=1, dan wordt ook het geselecteerde item van FromCombo overgenomen +FromCombo:UI.Lib.Ctrl.TComboBox,SetSelected:%Boolean=0 +0 +UI.Lib.Ctrl.TComboBox + + + + + +For internal use +TextBegin:%String +0 + + + + + +Als ForceTrigger = 1, dan wordt de event sowieso getriggered, ook als PrevIndex=..ItemIndex (Default ForceTrigger=0) +PrevIndex:%Integer,ForceTrigger:%Integer=0 +0 + "_..ItemIndex) + + Quit:('ForceTrigger)&&(PrevIndex=..ItemIndex) + Do tciFTriggerEvent(..OnChangeItem,$LB(%this,PrevIndex)) + Set ..FPrevIndex=..ItemIndex + Quit + + ;============================================================================= +tciFTriggerEvent(Event,Args) + Quit:(Event="") + //$LI(Event,1)=ORef waar de eventhandling is terug te vinden + //$LI(Event,2)=Naam van het uit te voeren event, te vinden in object met als oref=$LI(Event,1) + Do ..HandleEvent($LI(Event,1),$LI(Event,2),.Args) + Quit + +]]> + + + +Event:%String,Args:%String="" +0 + + + + + ResetItem )
    +Verdere uitleg: zie method SetTextItems() van +de klasse +VHSys.Lib.TMStrings
    ]]>     +Text:%String,Keys:%List,ResetItem:%Integer,CheckFlags:%Integer,RemoveFlags:%Integer +0 +%Library.String + +     + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +0 + + + + +Args:%String +cache +0 +document +literal + + + + + +de originele OnKeyDownOrig() method van TComboBox moet steeds opgeroepen worden
  • +de parameter Args moet hierbij als .Local doorgegeven worden
  • +de lijn "s Args=$lb(Sender,Key,Shift)", komende na ";End of user code", MOET in commentaar gezet worden (of verwijderen) + +

    +Method: ..cboExampleKeyDown(Args) +

    ...
+;Beginning of user code
+...
+Do Sender.OnKeyDownOrig(.Args)
+...
+;End of user code
+//s Args=$lb(Sender,Key,Shift)
+q
+
    ]]> +Args:%String +0 +-1) ..ItemIndex=..ItemIndex-1 + . Do okdSelectItem + . Do ..FTriggerChangeItem(..FPrevIndex) + Else If Key=$$$keyDown Do + . Set:(..ItemIndex<..Items.Count) ..ItemIndex=..ItemIndex+1 + . Do okdSelectItem + . Do ..FTriggerChangeItem(..FPrevIndex) + Else If Key=$$$keyHome Do + . Set ..ItemIndex=$S(..Items.Count>0:0, 1:-1) ; eerste item, of -1 als items="" + . Do okdSelectItem + . Do ..FTriggerChangeItem(..FPrevIndex) + Else If Key=$$$keyEnd Do + . Set:(..ItemIndex<..Items.Count) ..ItemIndex=..Items.Count-1 + . Do okdSelectItem + . Do ..FTriggerChangeItem(..FPrevIndex) + + ; Do not pass parameter values to ComboBox control + Set Key=0 + + ;End of user code + s Args=$lb(Sender,Key,Shift) + q + +okdSelectItem + Do ..SelectAll() + Set ..FUserInput="" + Quit + +]]> + + + + +de belangrijke informatie bij het gebruik van deze Method/Event is analoog aan de OnKeyDownOrig() method.]]> +Args:%String +0 + + + + +Index:%Integer +0 + + + + +Key:%String +0 + + + + +Text:%String +0 + + + + +0 +%Library.String + + + + +0 +%Library.String + + + + + +SetIndex() is 100% gelijk aan SelectByIndex() +Index:%Integer +0 + + + + +Msg:%String +0 + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +Canvas + + +CharCase + + +DropDownCount + + +DroppedDown + + +ItemHeight + + +ItemIndex + + +Items + + +MaxLength + + +OnChange + + +OnDrawItem + + +OnDropDown + + +OnMeasureItem + + +Query + + +SelLength + + +SelStart + + +SelText + + +Sorted + + +Style + + +PropName + + +ComboInput + + +OnChangeItem + + +PrevIndex + + +FPrevIndex + + +OnAfterFillItems + + +OnBeforeFillItems + + +LookUpOnExit + + +KeepAllKeys + + + + + Index: UI/Lib/Dlg/TFlyingMsg.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TFlyingMsg.cls.xml (revision 0) +++ UI/Lib/Dlg/TFlyingMsg.cls.xml (revision 61) @@ -0,0 +1,195 @@ + + + +serial +%Library.TMFormClass + + +%Library.TMForm + + + +%TMProgressBar + + + +%TMLabel + + + +%TMLabel + + + +%TMShape + + + +initvalue:%String +0 +%Status + + + + +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication + + + + +initvalue:%String +0 +%Library.Status + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Shape2 + + +lblMainMsg + + +lblSubMsg + + +shBack + + +ProgressBar + + + + + Index: UI/Lib/Ctrl/TCheckBox.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TCheckBox.cls.xml (revision 0) +++ UI/Lib/Ctrl/TCheckBox.cls.xml (revision 61) @@ -0,0 +1,380 @@ + + + + +Deze control kan de waarden van de checkbox beperken tot "True" of "False". +De control wordt dan automatisch ge-enabled of ge-disabled. +0 +0 +serial +0 +0 +%Library.TMCheckBox +0 + + + +Moet ingevuld worden via RestrictSet() ]]> +%Library.List +0 +0 + +$LB("True","False") +0 +0 +0 +0 +0 + + + + SetEnabled() . +Dit is noodzakelijk omdat TCheckbox op twee manieren kan ge-disabled worden (A: door het programma, B: indien slechts één waarde mogelijk).
    ]]>     +%Library.Boolean +0 +0 + +"True" +0 +0 +0 +0 +0 +     + + +0 +0 +code +lbBool:%List +0 +%Library.List +0 + + + + +0 +0 +code +lbAllow:%List,NewVal:%String="" +0 +0 + + + + +0 +0 +code +Enabled:%Boolean +0 +0 + + + + +%Library.CacheSerialState + +listnode + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +Alignment + + +AllowGrayed + + +Checked + + +State + + +PropName + + +FAllowValues + + +EnabledProg + + +FEnabledProg + + + +     +     Index: UI/Lib/Ctrl/TGrid.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TGrid.cls.xml (revision 0) +++ UI/Lib/Ctrl/TGrid.cls.xml (revision 61) @@ -0,0 +1,910 @@ + + + +serial +TGrid,%Const +Default +%Library.TMRxDrawGrid + + + +Indien bij bijv. SetCellValue enkel de value opgegeven wordt voor niet-selectie, +dan kan automatisch een copy gemaakt worden voor selectie ook, zoniet hebben +we een leeg veld bij selectie. +%Library.Boolean +1 + + + +%Library.Boolean +0 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.String +1 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + + +For internal use. + +generator +initvalue:%String +0 +%Library.Status + + + + +0 +%Library.Integer + + + + +0 +%Library.Integer + + + + +0 + + + + +IncludeFixed:%Boolean=0 +0 + + + + +Col,Row:%Integer +0 + + + + +FromCol,ToCol,FromRow,ToRow:%Integer,IncludeFixed:%Boolean=0 +0 + + + + +0 + + + + +Col:%Integer,EndOfDelete:%Boolean +0 +(..FixedCols+1) Do Quit + . Set:($D(EndOfDelete)) EndOfDelete=1 + . Do ..ClearCells(Col,Col,,,1) + + New ColLoop,RowLoop + For ColLoop=(Col+1):1:..ColCount Do + . For RowLoop=0:1:..RowCount-1 Do + .. Do ..FMoveCell(ColLoop,RowLoop,ColLoop-1,RowLoop) + . Do:('..FInUpdate) ..InvalidateCol(ColLoop-1) + + Set ..ColCount=..ColCount-1 + + Set:($D(EndOfDelete)) EndOfDelete=0 + + Quit + +]]> + + + +Row:%Integer +0 +(..FixedRows+1) Do Quit + . Do ..ClearCells(,,Row,Row,1) + + New RowLoop,ColLoop + For RowLoop=(Row+1):1:..RowCount Do + . For ColLoop=0:1:..ColCount-1 Do + .. Do ..FMoveCell(ColLoop,RowLoop,ColLoop,RowLoop-1) + . Do:('..FInUpdate) ..InvalidateRow(RowLoop-1) + + Set ..RowCount=..RowCount-1 + + Quit + +]]> + + + +0 + + + + +SrcCol,SrcRow,DestCol,DestRow:%Integer +0 + + + + +SrcCol,SrcRow,DestCol,DestRow:%Integer +0 + + + + +ColA,RowA,ColB,RowB:%Integer +0 + + + + +InsertBeforeCol:%Integer +0 +%Library.Boolean + + + + +InsertBeforeRow:%Integer +0 +%Library.Boolean + + + + +Args:%String +0 + + + + +SrcCol,SrcRow:%Integer +0 + + + + +SrcCol,SrcRow:%Integer +0 + + + + +Col,Row:%Integer,Color,SelColor:%Integer +0 + + + + +Col,Row:%Integer,Flags,SelFlags:%Integer +0 + + + + +Col,Row:%Integer,Color,SelColor:%Integer +0 + + + + +Col,Row:%Integer,Name,SelName:%Integer +0 + + + + +Col,Row:%Integer,Size,SelSize:%Integer +0 + + + + +Col,Row:%Integer,Style,SelStyle:%Integer +0 + + + + +Col,Row:%Integer,Value,SelValue:%String +0 + + + + +ColCount,RowCount:%Integer +0 +%Library.Boolean +..FixedCols) 0 + Quit:(RowCount'>..FixedRows) 0 + + Set ..ColCount=..FixedCols+ColCount + Set ..RowCount=..FixedRows+RowCount + + Quit 1 + +]]> + + + +RowA,RowB:%Integer +0 +%Library.Boolean + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +Canvas + + +IniStorage + + +OnAcceptEditKey + + +OnCancelEdit + + +OnChangeFocus + + +OnCheckButton + + +OnColumnSized + + +OnDrawCell + + +OnEditButtonClick + + +OnEditChange + + +OnFixedCellClick + + +OnGetEditAlign + + +OnGetEditLimit + + +OnGetEditStyle + + +OnGetPicklist + + +OnRowSized + + +OnShowEditor + + +FaFontStyle + + +FaCellColor + + +InUpdate + + +DefaultFixedRowColor + + +FInUpdate + + +IsEmpty + + +CopyToSelect + + +HandleValuesOnly + + +BMPFullBuffer + + +FInBuffering + + +FCanvasToUse + + +IgnoreValues + + + + + Index: UI/Lib/Dlg/TSetupDraaiTabel.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TSetupDraaiTabel.cls.xml (revision 0) +++ UI/Lib/Dlg/TSetupDraaiTabel.cls.xml (revision 61) @@ -0,0 +1,1163 @@ + + + +0 +0 +serial +0 +STRING +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.Boolean +0 +0 + +0 +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPage +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPage +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPage +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.List +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.List +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.List +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMCheckListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMCheckListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMCheckListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMNotebook +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPanel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 +' + ; Default = True + ; TabOrder = 0 + ; OnClick = btnNextClick + ; end + ; object btnCancel: CButton + ; Left = 299 + ; Top = 8 + ; Width = 75 + ; Height = 25 + ; Anchors = [akRight, akBottom] + ; Caption = 'Cancel' + ; TabOrder = 1 + ; OnClick = btnCancelClick + ; end + ; object btnBack: CButton + ; Left = 116 + ; Top = 8 + ; Width = 75 + ; Height = 25 + ; Anchors = [akRight, akBottom] + ; Caption = '< Back' + ; TabOrder = 2 + ; OnClick = btnBackClick + ; end + ; end + ;end + +]]> + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 +","True",0,$lb(%this,"btnNextClick"))) + d %this.btnCancel.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","Caption","TabOrder","OnClick"),$lb(299,8,75,25,$lb("akRight","akBottom"),"Cancel",1,$lb(%this,"btnCancelClick"))) + d %this.btnBack.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","Caption","TabOrder","OnClick"),$lb(116,8,75,25,$lb("akRight","akBottom"),"< Back",2,$lb(%this,"btnBackClick"))) + s MApplication.ClientState="Wait" + q + +]]> + + + +0 +0 +code + +0 +0 +'finish button' + . Do ..FinishWizard() + + Set ..nbWizard.PageIndex=..nbWizard.PageIndex+1 + + Do ..dCOMPUPDATEButtons() + + Do ..dCOMPINITnbPage() + + Quit + +]]> + + + +0 +0 +code +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +PageIndex:%Integer +0 +0 + Page0, het is namelijk de eerste pagina... + + ;------------------------------------------------------------------------------ + ; ROWs +dCOMPINITnbPage0() + Do ..clbRow.Clear() + Quit + + ;------------------------------------------------------------------------------ + ; COLs +dCOMPINITnbPage1() + Do ..clbColumn.Items.BeginUpdate() + Do ..clbColumn.Clear() + + New Loop + For Loop=0:1:..clbRow.Items.Count-1 Do + . If ..clbRow.GetChecked(Loop)="False" Do + .. Do ..clbColumn.Items.AddObject(..clbRow.Items.GetStrings(Loop),..clbRow.Items.GetObjects(Loop)) + + Do ..clbColumn.Items.EndUpdate() + Quit + + ;------------------------------------------------------------------------------ + ; DATA +dCOMPINITnbPage2() + Quit + +]]> + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +%Library.Boolean +0 +1) Do + . Set:(..clbColumn.GetChecked(Loop)="True") CheckCnt=CheckCnt+1 + + If CheckCnt'=1 Do Quit 0 + . Do MApplication.MessageBox("U dient één kolom-veld te selecteren.",..Form.Caption,$$$MBICONINFORMATION) + + Quit 1 + + ;------------------------------------------------------------------------------ + ; COUNTs +dCOMPVALnbPage2() + New Loop,CheckFound + Set CheckFound=0 + For Loop=0:1:..clbData.Items.Count-1 Quit:(CheckFound) Do + . Set:(..clbData.GetChecked(Loop)="True") CheckFound=1 + + If 'CheckFound Do Quit 0 + . Do MApplication.MessageBox("Er is/zijn geen gegevens-veld(en) geselecteerd.",..Form.Caption,$$$MBICONINFORMATION) + + Quit 1 + +]]> + + + +%Library.CacheSerialState + +listnode +"%Library.TMFormClass" + +Address + + +Form + + +Panel1 + + +Panel2 + + +Button1 + + +Button2 + + +Panel3 + + +Panel4 + + +Panel5 + + +Label1 + + +Notebook1 + + +NotebookPage1 + + +NotebookPage2 + + +NotebookPage3 + + +CheckListBox1 + + +CheckListBox2 + + +Label2 + + +btnNext + + +nbWizard + + +Bevel1 + + +Button3 + + +btnBack + + +btnCancel + + +clbColumn + + +clbRij + + +clbRow + + +Label3 + + +clbData + + +OldIndex + + +Dragging + + +pnlNav + + +OUTColumns + + +OUTData + + +OUTRows + + +OUTColumn + + +OUTRowsAndColumn + + + + + Index: UI/Res/Vertaling/MainForm.cls.xml =================================================================== diff -u --- UI/Res/Vertaling/MainForm.cls.xml (revision 0) +++ UI/Res/Vertaling/MainForm.cls.xml (revision 61) @@ -0,0 +1,3200 @@ + + + +serial +KeyCodesCNTs,ReportErrorCNTs,ProdVertalingCNTs +Default +%Library.TMFormClass + + +%TMSpeedButton + + + +%TMCheckBox + + + +%TMPopupMenu + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMEdit + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +CopyMode:%Integer,ToType:%String="" +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +3 + + + +1 + + + +2 + + + +%Library.SQLQuery +SELECT DISTINCT Groep FROM Res.Vertaling + + + + + + +%Library.SQLQuery +paGroep:%String +SELECT ID,Groep,Intern,RandInfo,Taal,Type,Vertaling FROM Res.Vertaling +WHERE Groep=:paGroep + + + + + + +%Library.String + + + +%Library.String +0 + + + +%Library.Integer +0 + + + +%Library.String +0 + + + +%Library.Integer +-1 + + + +%Library.Integer +-1 + + + +%Library.Integer + + + +%Library.String +"False" + + + +%Library.TMForm + + + +%TMGroupBox + + + +%TMGroupBox + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%TMPanel + + + +%TMPanel + + + +%TMPanel + + + +%Library.Integer + + + +%Library.Integer +0 + + + + +- TranslationBagKey=0 +er is geen translation meegegeven, dus alle vertalingen weergeven (filters werken wel nog) + +- TranslationBagKey=$$%J^vhRtn1(), dus maw een unieke global sleutel +de vertalingen aanwezig in de translationbag worden weergegeven, andere niet +Opmaak: TranslationBag(TranslationBagKey,Intern)=VertalingVerplicht +Bijv. voor het kenmerk kleur kunnen er volgende zaken in de bag zitten: +TranslationBag(1518002,"PRNr")=62361 PS: PRNr is steeds aanwezig in de tBag +TranslationBag(1518002,"Wit")="L" +TranslationBag(1518002,"Wit")="O" +TranslationBag(1518002,"Wit")="K" + +%Library.String +0 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMImageList + + + +%TMLabel + + + +%Library.String + + + +%TMPopupMenu + + + +%TMPopupMenu + + + +%TMPopupMenu + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMStringGrid + + + + +Wordt gebruikt bij zoekverrichtingen + +%Library.String +0 + + + +%Library.TMTimer + + + +%TMEdit + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +Row:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal +0) Do + . Set MApplication.ScreenCursor=$$$crHourGlass + . New Loop,tmpItem + . For Loop=0:1:(..SortedListView.lvItems.Items.Count-1) Do + .. Set tmpItem=..SortedListView.lvItems.Items.GetItems(Loop) + .. Quit:(tmpItem.Selected="False") + .. Set Intern=tmpItem.Caption + .. Set Type=tmpItem.SubItems.GetStrings(0) + .. Quit:((Intern="") || (Type="")) + .. If ..rVerwijderVertaling(Groep,Intern,Type)="" Do + ... Set DelCnt=DelCnt+1 + .. Else Do + ... Set DelErrCnt=DelErrCnt+1 + . Do ..EVENTRefresh(Args) + . Set MApplication.ScreenCursor=$$$crDefault + . If DelErrCnt>0 Do + .. Do MApplication.MessageBox(DelErrCnt _ " vertaling(en) niet verwijderd.",..Form.Caption,$$$MBICONEXCLAMATION) + + ;End of user code + s Args=$lb(Sender) + q +]]> + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Groep,Intern,VertalingsType:%String,FullName:%Integer=0 +cache +0 +%Library.String +document +literal + + + + +Groep,Intern,VertalingsType:%String +cache +0 +%Library.Integer +document +literal + + + + +ClassName:%String +cache +0 +%Library.Integer +document +literal + + + + +cache +0 +document +literal + SQL wildcards + . Set WHEREStr=$TR(WHEREStr,"?","_") + . Set WHEREStr="UPPER(Intern) LIKE '" _ WHEREStr _ "'" + Quit WHEREStr + +GetVertalingClause() + New WHEREStr + Set WHEREStr="" + If ..chkVertalingFilter.Checked="True" Do + . Set WHEREStr=$ZCONVERT(..txtVertalingFilter.Text,"U") + . Set WHEREStr=$TR(WHEREStr,"*","%") //Klassieke wildcards -> SQL wildcards + . Set WHEREStr=$TR(WHEREStr,"?","_") + . Set WHEREStr="UPPER(Vertaling) LIKE '" _ WHEREStr _ "'" + Quit WHEREStr + +]]> + + + +cache +0 +%Library.Boolean +document +literal + + + + + +Via Text + +Text:%String="" +cache +0 +%Library.Integer +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +ErrorType:%Integer,Msg:%String="",Silent:%Boolean="False",MsgBoxType=0 +cache +0 +document +literal + + + + + +Clean application shutdown + +cache +0 +document +literal +BUG MAKOVA + //----------------------------------------------------------------------------- + + //Vrijgeven Column Definitie + Do ..CloseColumnDef() + + //Vrijgeven eventuele listpump forms + If ..ListPumpTaal'=0 Do + . Do ..ListPumpTaal.%Close() + + If ..ListPumpType'=0 Do + . Do ..ListPumpType.%Close() + + //Vrijgeven van de detailform + If ..DetailForm'=0 Do + . Set ..DetailForm.FinalClose="True" + . Do ..DetailForm.%Close() + //Vrijgeven van de detaillinkform + If ..DetailLinkForm'=0 Do + . Set ..DetailLinkForm.FinalClose="True" + . Do ..DetailLinkForm.%Close() + + Quit + +]]> + + + +cache +0 +document +literal +MaxIDColIndex Set MaxIDColIndex=ColIndex + + //Verwijderen vorige kolommen + Do ..ClearTaalColumnDef() + + //Inlezen van de huidig geselecteerde talen + New TalenOK,Loop,tmpTaal,tmpTaalID + Set TalenOK=..ListPumpTaal.GetDestViaPieces("/") + For Loop=1:1:$L(TalenOK,"/") Quit:(TalenOK="") Do + . Set tmpTaalID=$P($P(TalenOK,"/",Loop),": ",1) //bijv. 'N' + . Set tmpTaal=$P($P(TalenOK,"/",Loop),": ",2) //bijv. 'Nederlands' + . Set ColIndex=MaxIDColIndex+Loop + . Set ColumnDef($$$cdTaal,tmpTaalID)=$LB(ColIndex,0,"False",tmpTaal) + . Set ColumnDefIndex(ColIndex)=$LB($$$cdTaal,tmpTaalID) + + Quit + +]]> + + + +Row:%Integer +cache +0 +document +literal + + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal +lock niet gelukt! + + If LockGranted="False" Do + . Do MApplication.MessageBox("De geselecteerde vertaling wordt momenteel aangepast, probeer later opnieuw.","VAN HOECKE",$$$MBICONINFORMATION) + + Quit LockGranted + +]]> + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +Row:%Integer +cache +0 +%Library.String +document +literal + + + + +Row:%Integer +cache +0 +%Library.String +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +ListPump:UI.Lib.Dlg.ListDataPump,Caption:%String,UpDownVisible:%Boolean="False" +cache +0 +document +literal + + + + +ColumnType:%Integer +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Groep,Intern,Type:%String +cache +0 +%Library.String +document +literal + + + + +cache +0 +document +literal +zo ja, save, zo nee reset+quit + New Vertaling + Set Vertaling=..sgVertalingen.GetCells(..FEditCol,..FEditRow) + If ..FEditValue=Vertaling Do Quit + . Set ..FEditCol=-1 //Reset Vars + . Set ..FEditRow=-1 + . Set ..FEditValue="" + + //Niet saven wanneer controlcharacters in vertaling, dan is dit reeds gebeurd ih detailscherm + Quit:(..HasControlChars(Vertaling)) + + New Groep + Set Groep=..dCOMPREADGroep() + Quit:(Groep="") + + New Intern + Set Intern=..dCOMPREADIntern(..FEditRow) + Quit:(Intern="") + + New VertalingsType + Set VertalingsType=..dCOMPREADVertalingsType(..FEditRow) + Quit:(VertalingsType="") + + New Taal + Set Taal=$LI(ColumnDefIndex(..FEditCol),2) + Quit:(Taal="") + + New tmpID + Set tmpID=Groep_"||"_Intern_"||"_VertalingsType_"||"_Taal + + New VertalingsObj + Set VertalingsObj=##class(Res.VertalingAbstract).%OpenId(tmpID) + If VertalingsObj=$$$NULLOREF Do + . New ClassName + . Set ClassName=..GetRelatedClassName(Groep,Intern,VertalingsType,1) + . Quit:(ClassName="") + . Xecute "Set VertalingsObj=##class("_ClassName_").%New()" + . If VertalingsObj=$$$NULLOREF Do ..ReportError($$$reCannotCreateNewObj,"Res.VertalingAbstract") + . Do VertalingsObj.GroepSetObjectId(Groep) + . Set VertalingsObj.Intern=Intern + . Do VertalingsObj.TypeSetObjectId(VertalingsType) + . Do VertalingsObj.TaalSetObjectId(Taal) + Quit:(VertalingsObj=$$$NULLOREF) + Set VertalingsObj.Vertaling=Vertaling + Set ..lblMsg.Caption="Bezig met opslaan... even geduld." + Do ..VertalingLOCK(Groep,Intern,VertalingsType,Taal) + Set tmpStatus=VertalingsObj.%Save() + Do ..VertalingUNLOCK(Groep,Intern,VertalingsType,Taal) + Set ..lblMsg.Caption="" + If $$$ISERR(tmpStatus) Do ..ReportError($$$reStatusError,tmpStatus) + Do VertalingsObj.%Close() + + Set ..FEditCol=-1 + Set ..FEditRow=-1 + Set ..FEditValue="" + + Quit + +]]> + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +N + + + +%Library.CacheSerialState + +list +"%Library.TMFormClass" + +Address + + +Form + + +Label1 + + +Panel1 + + +Panel2 + + +Panel3 + + +StringGrid + + +btnAnnuleren + + +cbbGroep + + +chkAlleenNietVertaalde + + +chkFrans + + +chkIncludeLabel + + +chkIncludeOmschrijving + + +chkNederlands + + +lvVertalingen + + +Label2 + + +Label3 + + +Panel4 + + +btnSaveAsNew + + +lblVertaling + + +txtIntern + + +txtType + + +txtVertaling + + +Label4 + + +txtTaal + + +btnDelete + + +chkIncludeKortOmsch + + +Label5 + + +btnSave + + +SortCol + + +Bevel1 + + +btnRefresh + + +tmrUpdate + + +Panel5 + + +chkIncludeIntern + + +txtSearchStr + + +TranslationBagKey + + +tmpSearchIndex + + +ilVlaggen + + +SpeedButton1 + + +btnVoorbeeld + + +CurrentLockVertaling + + +StringGrid1 + + +lblBewerkingen + + +CheckListBox1 + + +CheckListBox2 + + +StatusBar1 + + +CheckBox1 + + +CheckBox2 + + +CheckBox3 + + +Edit1 + + +GroupBox1 + + +GroupBox2 + + +SpeedButton2 + + +SpeedButton3 + + +pmTalen + + +pmTypes + + +Button1 + + +ListPumpTaal + + +ListPumpType + + +btnFilterTaal + + +btnFilterType + + +chkAlleTalen + + +chkAlleTypes + + +chkInternFilter + + +sgVertalingen + + +txtInternFilter + + +btnDetailsBekijken + + +btnNieuweVertaling + + +btnVertalingVerwijderen + + +DetailForm + + +FEditCol + + +FEditRow + + +FEditValue + + +lblMsg + + +Memo1 + + +FinalClose + + +DetailLinkForm + + +pmNieuweVertaling + + +pmiVertaling + + +pmiWebLink + + +pmVoorbeeldTalen + + +BaseURL + + +SortedListView + + +pLastGroep + + +pmVertalingVerwijderen + + +pmiDelSelVertaling + + +pmiViaLijst + + +pmiDelViaLijst + + +btnCopyTrans + + +pmCopyTrans + + +pmiCopySelTrans + + +pmiCopySelTransAllTypes + + +pmiCopySelTransToType + + +pmiSep1 + + +chkVertalingFilter + + +txtVertalingFilter + + + + + Index: UI/Lib/Dlg/ReportError.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/ReportError.cls.xml (revision 0) +++ UI/Lib/Dlg/ReportError.cls.xml (revision 61) @@ -0,0 +1,960 @@ + + + +serial +ReportErrorCNTs,KeyCodesCNTs +%Library.TMFormClass + + +%Library.Integer + + + +%Library.Integer + + + +%Library.Integer + + + +%Library.Integer + + + +%Library.String + + + +%Library.String + + + +%Library.TMForm + + + +%Library.String +"False" + + + +%TMShape + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMLabel + + + +%TMLabel + + + +%TMPanel + + + +%TMRichEdit + + + +initvalue:%String +0 +%Status + + + + +0 + + + + +0 +>' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnDetailsClick + ; end + ; object btnOk: CSpeedButton + ; Left = 422 + ; Top = 74 + ; Width = 79 + ; Height = 22 + ; Anchors = [akTop, akRight] + ; Color = 8961416 + ; Caption = '&Ok' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [fsBold] + ; ParentFont = False + ; OnClick = btnOkClick + ; end + ; object pnlDetails: CPanel + ; Left = 7 + ; Top = 111 + ; Width = 494 + ; Height = 345 + ; Color = 12058566 + ; TabOrder = 0 + ; Visible = False + ; object btnStackDump: CSpeedButton + ; Left = 8 + ; Top = 8 + ; Width = 88 + ; Height = 21 + ; Color = 11522991 + ; Caption = '&Stackdump...' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnStackDumpClick + ; end + ; object btnLastObjErr: CSpeedButton + ; Left = 104 + ; Top = 8 + ; Width = 88 + ; Height = 21 + ; Color = 11522991 + ; Caption = '&Last object error' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnLastObjErrClick + ; end + ; object btnWatchWindow: CSpeedButton + ; Left = 200 + ; Top = 8 + ; Width = 88 + ; Height = 21 + ; Color = 11522991 + ; Caption = '&Watch window' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnWatchWindowClick + ; end + ; object btnCacheSpy: CSpeedButton + ; Left = 296 + ; Top = 8 + ; Width = 88 + ; Height = 21 + ; Color = 11522991 + ; Caption = '&Cache dbug spy' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnCacheSpyClick + ; end + ; object btnExecute: CSpeedButton + ; Left = 454 + ; Top = 318 + ; Width = 31 + ; Height = 21 + ; Anchors = [akRight, akBottom] + ; Color = 11522991 + ; Caption = '&Go' + ; Font.Charset = DEFAULT_CHARSET + ; Font.Color = clBlack + ; Font.Height = -11 + ; Font.Name = 'MS Sans Serif' + ; Font.Style = [] + ; ParentFont = False + ; OnClick = btnExecuteClick + ; end + ; object reDetails: CRichEdit + ; Left = 8 + ; Top = 35 + ; Width = 478 + ; Height = 278 + ; Anchors = [akLeft, akTop, akRight, akBottom] + ; Color = 15794163 + ; Font.Charset = ANSI_CHARSET + ; Font.Color = clWindowText + ; Font.Height = -11 + ; Font.Name = 'Courier New' + ; Font.Style = [] + ; ParentFont = False + ; ScrollBars = ssVertical + ; TabOrder = 0 + ; end + ; object cbbExecute: CComboBox + ; Left = 8 + ; Top = 319 + ; Width = 447 + ; Height = 21 + ; Anchors = [akLeft, akRight, akBottom] + ; ItemHeight = 13 + ; TabOrder = 1 + ; OnKeyDown = cbbExecuteKeyDown + ; end + ; end + ;end +]]> + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication +>","False",$lb(%this,"btnDetailsClick"))) + d %this.btnDetails.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.btnOk.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","Color","Caption","ParentFont","OnClick"),$lb(422,74,79,22,$lb("akTop","akRight"),8961416,"&Ok","False",$lb(%this,"btnOkClick"))) + d %this.btnOk.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb("fsBold"))) + d %this.pnlDetails.SetMultiProperty($lb("Left","Top","Width","Height","Color","TabOrder","Visible"),$lb(7,111,494,345,12058566,0,"False")) + d %this.btnStackDump.SetMultiProperty($lb("Left","Top","Width","Height","Color","Caption","ParentFont","OnClick"),$lb(8,8,88,21,11522991,"&Stackdump...","False",$lb(%this,"btnStackDumpClick"))) + d %this.btnStackDump.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.btnLastObjErr.SetMultiProperty($lb("Left","Top","Width","Height","Color","Caption","ParentFont","OnClick"),$lb(104,8,88,21,11522991,"&Last object error","False",$lb(%this,"btnLastObjErrClick"))) + d %this.btnLastObjErr.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.btnWatchWindow.SetMultiProperty($lb("Left","Top","Width","Height","Color","Caption","ParentFont","OnClick"),$lb(200,8,88,21,11522991,"&Watch window","False",$lb(%this,"btnWatchWindowClick"))) + d %this.btnWatchWindow.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.btnCacheSpy.SetMultiProperty($lb("Left","Top","Width","Height","Color","Caption","ParentFont","OnClick"),$lb(296,8,88,21,11522991,"&Cache dbug spy","False",$lb(%this,"btnCacheSpyClick"))) + d %this.btnCacheSpy.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.btnExecute.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","Color","Caption","ParentFont","OnClick"),$lb(454,318,31,21,$lb("akRight","akBottom"),11522991,"&Go","False",$lb(%this,"btnExecuteClick"))) + d %this.btnExecute.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$DEFAULTCHARSET,$$$clBlack,-11,"MS Sans Serif",$lb())) + d %this.reDetails.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","Color","ParentFont","ScrollBars","TabOrder"),$lb(8,35,478,278,$lb("akLeft","akTop","akRight","akBottom"),15794163,"False","ssVertical",0)) + d %this.reDetails.Font.SetMultiProperty($lb("Charset","Color","Height","Name","Style"),$lb($$$ANSICHARSET,$$$clWindowText,-11,"Courier New",$lb())) + d %this.cbbExecute.SetMultiProperty($lb("Left","Top","Width","Height","Anchors","ItemHeight","TabOrder","OnKeyDown"),$lb(8,319,447,21,$lb("akLeft","akRight","akBottom"),13,1,$lb(%this,"cbbExecuteKeyDown"))) + s MApplication.ClientState="Wait" + q +]]> + + + +initvalue:%String +0 +%Library.Status + + + + +Place,Error,Msg:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 +>" + . Set ..Form.ClientHeight=105 + . ;Set ..Form.ClientWidth=354 + . Do ..CenterForm() + . Set Sender.Tag=0 + + ;End of user code + s Args=$lb(Sender) + q + +]]> + + + +Args:%String +0 +",1)_ "> ") + Do ..reDetails.Lines.Add("") + Set ..reDetails.SelAttributes.Style=$LB() + Do ..reDetails.Lines.Add(ShowCode) + Quit + + +]]> + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Shape + + +SpeedButton1 + + +SpeedButton2 + + +SpeedButton3 + + +lblError + + +lblMsg + + +btnDetails + + +btnOk + + +btnReportError + + +btnToonDetails + + +cbbDetailType + + +reDetails + + +btnLastObjErr + + +btnStackDump + + +btnExecute + + +txtXecute + + +btnWatchWindow + + +ErrorPlace + + +Bevel1 + + +Panel1 + + +pnlDetails + + +ExtraSendMsg + + +BaseX + + +BaseY + + +Moving + + +BaseLeft + + +BaseTop + + +btnCacheSpy + + +cbbExecute + + + + + Index: UI/Res/Vertaling/dlgDetail.cls.xml =================================================================== diff -u --- UI/Res/Vertaling/dlgDetail.cls.xml (revision 0) +++ UI/Res/Vertaling/dlgDetail.cls.xml (revision 61) @@ -0,0 +1,1044 @@ + + + +serial +ReportErrorCNTs,DetailVertalingAbstractCNTs,KeyCodesCNTs +Default +%Library.TMFormClass +0 + + +%Library.String + + + + +Aangezien het OnDestroy event van DesignForm ten huidige +tijde nog niet geïmplementeerd is, is deze boolean een noodzaak. +Wanneer False, dan wordt TaalObj e.d. niet afgesloten, anders wel... + +%Library.Boolean +"False" + + + +%Library.TMForm + + + +%TMGroupBox + + + +%Library.Boolean +0 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMGroupBox + + + +%TMScrollBox + + + +%TMEdit + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +Groep,Intern,VertalingsType:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Groep:%String +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +ErrorType:%Integer,Msg:%String="",Silent:%Boolean="False",MsgBoxType=0 +cache +0 +document +literal + + + + +cache +0 +%Library.Boolean +document +literal + + + + +VertalingsType +cache +0 +document +literal + + + + +TaalID:%Library.String +cache +0 +document +literal + + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal +lock niet gelukt! + + If LockGranted="False" Do + . Do MApplication.MessageBox("De geselecteerde vertaling wordt momenteel aangepast, probeer later opnieuw.","VAN HOECKE",$$$MBICONINFORMATION) + + Quit LockGranted +]]> + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Index:%Integer +cache +0 +%Library.String +document +literal + + + + +cache +0 +document +literal +0) ..cbbVertalingsType.ItemIndex=0 + + Quit + + //----------------------------------------------------------------------------- +AddToTypePump(ToList,Value,Object) + Do ToList.Items.Add(Object_": "_Value) + Quit +]]> + + + +%Library.CacheSerialState + +list +"%Library.TMFormClass" + +Address + + +Form + + +ComboBox1 + + +Edit1 + + +GroupBox1 + + +GroupBox2 + + +Image1 + + +Label1 + + +Label2 + + +Label3 + + +Memo1 + + +Memo2 + + +Memo3 + + +SpeedButton1 + + +SpeedButton2 + + +Button1 + + +PaintBox1 + + +ScrollBox1 + + +btnAnnuleren + + +btnOk + + +cbbVertalingsType + + +gbVertalingen + + +txtIntern + + +sbVertalingen + + +CurrentGroep + + +FinalClose + + +CheckBox1 + + +chkEenRegelNav + + +chkWordWrap + + +IsNewTranslation + + +btnOkAndNext + + + + + Index: UI/Lib/Ctrl/TEdit5.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TEdit5.cls.xml (revision 0) +++ UI/Lib/Ctrl/TEdit5.cls.xml (revision 61) @@ -0,0 +1,1110 @@ + + + +serial +VHCtrlCNTs,KeyCodesCNTs,%Const +Default +%Library.TMEdit + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Boolean +0 + + + +%Library.Integer +$$$clRed + + + +%Library.Integer +$$$clYellow + + + +%Library.Integer +$$$clWhite + + + +%Library.Integer +$$$clBlack + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%Library.String +$$$NULLOREF + + + +%Library.String + + + +%Library.String + + + +%Library.Integer + + + +%Library.Integer +0 + + + +%Library.Float + + + +%Library.Boolean +1 + + + +%Library.Integer +0 + + + +%Library.Float + + + +%Library.Boolean +1 + + + +%Library.String +200 + + + +%Library.Boolean +1 + + + +%Library.Boolean +1 + + + +%Library.String + + + +%Library.String + + + +%Library.List + + + +%Library.String + + + +%Library.Integer +0 + + + +%Library.Boolean +1 + + + +%Library.Integer +$$$etNone + + + +%Library.List + + + +%Library.Boolean +1 + + + + +3=Ctrl+C +22=Ctrl+V +24=Ctrl+X +%Library.List +$LB($$$keyBackspace,$$$keyTab,$$$keyEnter,$$$keyEsc,3,22,24) + + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +cache +0 +document +literal + + + + +Origin,Type:%Library.Integer,Header,Body:%Library.String +cache +0 +document +literal + + + + +Value,RawValue:%Library.String +cache +0 +document +literal + + + + +Header,Body:%Library.String,Type:%Library.Integer +cache +0 +document +literal + + + + +Event:%Library.String,Args:%Library.List +cache +0 +document +literal + + + + +Key,ChangedKey:%Library.String,Type:%Library.Integer,Text:%Library.String +cache +0 +document +literal + readonly veld... + ; *** INTEGER *** + Else If Type=$$$etInteger Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If Key'?1N Do Quit + .. Set ChangedKey=$C(0) + .. Do SendSimpleKeyMsg(KeyAsNr,"Enkel cijfers zijn toegelaten.") + . If (Key="0") && (Text="") Do Quit + .. Set ChangedKey=$C(0) + . Set ValidateOk=1 + ; *** FLOAT *** + Else If Type=$$$etFloat Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . New KeyIsNr,KeyIsComma,KeyIsMin + . Set KeyIsNr=(Key?1N), KeyIsComma=(Key="."), KeyIsMin=(Key="-") + . If ('KeyIsNr && 'KeyIsComma && 'KeyIsMin) Do Quit ;Eerst de key checken of deze geldig is + .. Set ChangedKey=$C(0) + .. Do SendSimpleKeyMsg(KeyAsNr,"Enkel cijfers, een min-teken of een komma zijn toegelaten.") + . If KeyIsMin && (Text'="") Do Quit ;Checken of '-' geldig is + .. Set ChangedKey=$C(0) + . If KeyIsComma && (Text="") Do Quit ;Checken of '.' geldig is (mag niet als eerste char staan) + .. Set ChangedKey=$C(0) + . If KeyIsNr && (Text="0") Do Quit ;Checken of niet reeds een '0' voorop staat + .. Set ChangedKey=$C(0) + . If KeyIsComma && ($F(Text,".")'=0) Do Quit ;Checken of komma geldig is (maximum één) + .. Set ChangedKey=$C(0) + . Set ValidateOk=1 + ; *** ALPHA *** + Else If Type=$$$etAlpha Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If Key'?1(1A,1" ") Do Quit + .. Set ChangedKey=$C(0) + .. Do SendSimpleKeyMsg(KeyAsNr,"Enkel letters en spaties zijn toegelaten.") + . Set ValidateOk=1 + ; *** ALPHA LOWER CASE *** + Else If Type=$$$etAlphaLowerCase Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If Key'?1(1L,1" ") Do Quit + .. If ..ChangeToType && (KeyAsNr>64) && (KeyAsNr<91) Do ;LowerCase->UpperCase + ... Set ChangedKey=$C(KeyAsNr+32) + ... Do SendSimpleKeyMsg(KeyAsNr,"Enkel kleine letters en spaties zijn toegelaten. De toets werd aangepast.") + .. Else Do + ... Set ChangedKey=$C(0) + ... Do SendSimpleKeyMsg(KeyAsNr,"Enkel kleine letters en spaties zijn toegelaten.") + . Set ValidateOk=1 + ; *** ALPHA UPPER CASE *** + Else If Type=$$$etAlphaUpperCase Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If Key'?1(1U,1" ") Do Quit + .. If ..ChangeToType && (KeyAsNr>96) && (KeyAsNr<123) Do ;LowerCase->UpperCase + ... Set ChangedKey=$C(KeyAsNr-32) + ... Do SendSimpleKeyMsg(KeyAsNr,"Enkel hoofdletters en spaties zijn toegelaten. De toets werd aangepast.") + .. Else Do + ... Set ChangedKey=$C(0) + ... Do SendSimpleKeyMsg(KeyAsNr,"Enkel hoofdletters en spaties zijn toegelaten.") + . Set ValidateOk=1 + ; *** PATTERN *** + Else If Type=$$$etPattern Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If ..Pattern="" Do Quit + .. Do ..FSendMessage($$$moCode,$$$MBICONERROR,"Interne fout","Er is geen pattern opgegeven.") + .. Set ..Pattern=".E" ;Pattern tijdelijk veranderen in 'alles' + . If Key'?@..Pattern Do Quit + .. Set ChangedKey=$C(0) + .. Do SendSimpleKeyMsg(KeyAsNr,..HelpStr) + . Set ValidateOk=1 + ; *** USER DEFINED SET *** + Else If Type=$$$etUserDefinedSet Do + . Quit:('$$keyCheckMaxLen(Text,.ChangedKey)) + . If ..UserDefinedSet'[Key Do Quit + .. Set ChangedKey=$C(0) + .. New UDSStr + .. Set UDSStr=$S(..HelpStr="":"Enkel volgende karakters zijn geldig: '"_..UserDefinedSet_"'.",1:..HelpStr) + .. Do SendSimpleKeyMsg(KeyAsNr,UDSStr) + . Set ValidateOk=1 + ; *** CALC *** + Else If Type=$$$etCalc Do + . If "0123456789()+-*/."'[Key Do Quit + .. Set ChangedKey=$C(0) + .. Do SendSimpleKeyMsg(KeyAsNr,"Enkel een cijfer, haakje, komma of operator is toegelaten.") + . Set ValidateOk=1 + ; *** OWNER VALIDATE *** + Else If Type=$$$etOwnerValidate Do + . New SendMessage,MsgHeader,MsgBody + . Set SendMessage=1 + . Set MsgHeader="Ongeldige toets" + . Set MsgBody="De toets is niet toegestaan." + . New Args + . Set Args=$LB(%this,Key,ValidateOk,SendMessage,MsgHeader,MsgBody) + . Do ..FTriggerEvent(..OnValidateKey,.Args) + . Set ChangedKey=$LG(Args,2,Key) + . Set ValidateOk=$LG(Args,3,ValidateOk) + . If 'ValidateOk Do + .. Set SendMessage=$LG(Args,4,SendMessage) + .. If SendMessage Do + ... Do ..FSendMessage($$$moUser,$$$MBICONINFORMATION,$LG(Args,5,MsgHeader),$LG(Args,6,MsgBody)) + + Quit ValidateOk + + ;============================================================================== +TranslateKey(KeyAsNr) + If KeyAsNr=8 Do Quit "backspace" + Else If KeyAsNr=9 Do Quit "tab" + Else If KeyAsNr=13 Do Quit "enter" + Else If KeyAsNr=27 Do Quit "escape" + Quit "#"_KeyAsNr + + ;============================================================================== +SendSimpleKeyMsg(KeyAsNr,AddToHelpStr) + New HelpStr + If (KeyAsNr=127) || (KeyAsNr<32) Do ;CONTROLE CHARs + . Set HelpStr="De toets '"_$$TranslateKey(KeyAsNr)_"' is niet geldig" + Else Do + . Set HelpStr="De toets '"_Key_"' is niet geldig" + Set HelpStr=HelpStr_$S($G(AddToHelpStr)="":".",1:": "_AddToHelpStr) + Do ..FSendMessage($$$moUser,$$$MBICONEXCLAMATION,"Ongeldige toets",HelpStr) + Quit + + ;============================================================================== +keyCheckMaxLen(Val,ChangedKey) + Quit:('..CheckMaxLen) 1 + If ($L(Val)+1)>..MaxLen Do Quit 0 + . Set ChangedKey=$C(0) + . Do ..FSendMessage($$$moUser,$$$MBICONINFORMATION,"Maximum lengte","Het maximum aantal karakters is "_..MaxLen_".") + Quit 1 +]]> + + + +Value,ChangedValue:%Library.String,MsgOrigin,Type:%Library.Integer +cache +0 +%Library.Boolean +document +literal +..Scale Do + ... If +..Scale=0 Do + .... Do ..FSendMessage($$$moCode,$$$MBICONERROR,"Interne fout","Er is geen scale-waarde opgegeven!") + .... Set ..Scale=2 ;Tijdelijke waarde toekennen + ... Else If ..Scale=1 Do + .... Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Ongeldige waarde","Enkel 1 cijfer na de komma is toegestaan.") + .... Set:(..ChangeToType) ChangedValue=$E(Value,1,$Find(Value,".")+..Scale-1) + ... Else If ..Scale>1 Do + .... Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Ongeldige waarde","Enkel "_..Scale_" cijfers na de komma zijn toegestaan.") + .... Set:(..ChangeToType) ChangedValue=$E(Value,1,$Find(Value,".")+..Scale-1) + ... Else Do + .... Set ScaleError=0 + .. Else Do + ... Set ScaleError=0 + . Else Do + .. Set ScaleError=0 + . Quit:(ScaleError) + . Quit:('$$CheckMaxVal(Value,.ChangedValue)) + . Quit:('$$CheckMinVal(Value,.ChangedValue)) + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** ALPHA *** + Else If Type=$$$etAlpha Do + . Quit:('$$CheckPattern(Value,".(1A,1"" "")","Enkel letters zijn toegelaten.")) + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** ALPHA LOWER CASE *** + Else If Type=$$$etAlphaLowerCase Do + . If '$$CheckPattern(Value,".(1L,1"" "")","Enkel kleine letters en spaties zijn toegelaten.") Do Quit + .. Set:(..ChangeToType) ChangedValue=$ZCVT(Value,"L") + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** ALPHA UPPER CASE *** + Else If Type=$$$etAlphaUpperCase Do + . If '$$CheckPattern(Value,".(1U,1"" "")","Enkel hoofdletters en spaties zijn toegelaten.") Do Quit + .. Set:(..ChangeToType) ChangedValue=$ZCVT(Value,"U") + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** PATTERN *** + Else If Type=$$$etPattern Do + . If ..Pattern="" Do Quit + .. Do ..FSendMessage($$$moCode,$$$MBICONERROR,"Interne fout","Er is geen pattern opgegeven.") + .. Set ..Pattern=".E" ;Pattern tijdelijk veranderen in 'alles' + . Quit:('$$CheckPattern(Value,..Pattern,..HelpStr)) + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** USER DEFINED SET *** + Else If Type=$$$etUserDefinedSet Do + . If $TR(Value,..UserDefinedSet,"")'="" Do Quit + .. New UDSStr + .. Set UDSStr=$S(..HelpStr="":"Enkel volgende karakters zijn geldig: '"_..UserDefinedSet_"'.",1:..HelpStr) + .. Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Ongeldige waarde",UDSStr) + . Quit:('$$CheckMaxLen(Value,.ChangedValue)) + . Quit:('$$CheckMinLen(Value,.ChangedValue)) + . Set ValidateOk=1 + ; *** CALC *** + Else If Type=$$$etCalc Do + . If Value="" Do Quit + .. Set ChangedValue=0 + . Quit:('$$CheckPattern(Value,".(1N,1""("",1"")"",1""*"",1""+"",1""/"",1""-"",1""."")","Enkel cijfers, haakjes, komma's en operators zijn toegelaten.")) + . New Result,XStatus + . Set XStatus=$$iXecute^vhLib("Set Result="_Value) + . If XStatus'="" Do Quit + .. Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Ongeldige expressie","De opgegeven expressie is niet geldig.") + . Set ChangedValue=Result + . Set ValidateOk=1 + ; *** OWNER VALIDATE *** -> Schrijf uw eigen validatie-routine en koppel ah event OnValidate + Else If Type=$$$etOwnerValidate Do + . New SendMessage,MsgHeader,MsgBody + . Set SendMessage=1 + . Set MsgHeader="Ongeldige waarde" + . Set MsgBody="De opgegeven waarde is niet toegestaan." + . New Args + . Set Args=$LB(%this,Value,ValidateOk,SendMessage,MsgHeader,MsgBody) + . Do ..FTriggerEvent(..OnValidateValue,.Args) + . Set ChangedValue=$LG(Args,2,Value) + . Set ValidateOk=$LG(Args,3,ValidateOk) + . If 'ValidateOk Do + .. Set SendMessage=$LG(Args,4,SendMessage) + .. If SendMessage Do + ... Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,$LG(Args,5,MsgHeader),$LG(Args,6,MsgBody)) + + Quit ValidateOk + + ;============================================================================== +CheckPattern(Val,Pattern,PatternHelpStr) ;PatternHelpStr is enkel een gebruiksvriendelijke vertaling van de pattern + If Val'?@Pattern Do Quit 0 + . New PatternStr + . Set PatternStr="De opgegeven waarde is niet geldig"_$S($G(PatternHelpStr)="":".",1:": "_PatternHelpStr) + . Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Ongeldige waarde",PatternStr) + Quit 1 + + ;------------------------------------------------------------------------------ +CheckMaxVal(Val,ChangedVal) + Quit:('..CheckMaxVal) 1 + Quit:(..MaxValIsAllowed && (Val=..MaxVal)) 1 + If Val'<..MaxVal Do Quit 0 + . New MaxStr + . If ..MaxValIsAllowed Do + .. Set MaxStr="De maximum waarde bedraagt "_..MaxVal_"." + . Else Do + .. Set MaxStr="De waarde moet kleiner zijn dan "_..MaxVal_"." + . Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Maximum waarde",MaxStr) + . Set:(..ChangeToMaxVal && ..MaxValIsAllowed) ChangedVal=..MaxVal + Quit 1 + + ;------------------------------------------------------------------------------ +CheckMinVal(Val,ChangedVal) + Quit:('..CheckMinVal) 1 + Quit:(..MinValIsAllowed && (Val=..MinVal)) 1 + If Val'>..MinVal Do Quit 0 + . New MinStr + . If ..MinValIsAllowed Do + .. Set MinStr="De minimum waarde bedraagt "_..MinVal_"." + . Else Do + .. Set MinStr="De waarde moet groter zijn dan "_..MinVal_"." + . Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Minimum waarde",MinStr) + . Set:(..ChangeToMinVal && ..MinValIsAllowed) ChangedVal=..MinVal + Quit 1 + + ;============================================================================== +CheckMaxLen(Val,ChangedVal) + #Define ChangeToMaxLen Set:(..ChangeToMaxLen) ChangedVal=$E(Val,1,..MaxLen) + If '..CheckMaxLen Do Quit 1 + . $$$ChangeToMaxLen + If $L(Val)>..MaxLen Do Quit 0 + . Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Maximum lengte","Het maximum aantal karakters is "_..MaxLen_".") + . $$$ChangeToMaxLen + Quit 1 + + ;------------------------------------------------------------------------------ +CheckMinLen(Val,ChangedVal) + Quit:('..CheckMinLen) 1 + If $L(Val)<..MinLen Do Quit 0 + . Do ..FSendMessage(MsgOrigin,$$$MBICONINFORMATION,"Minimum lengte","Het minimum aantal karakters is "_..MinLen_".") + Quit 1 +]]> + + + +Args:%Library.List +cache +0 +document +literal + + + + +Args:%Library.String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Value:%Library.String +cache +0 +%Library.Status +document +literal + + + + +Parent:%Library.String,LeftOffset,TopOffset:%Library.Integer +cache +0 +document +literal + + + + + +Method for getting 'Text' property. + +cache +0 +%Library.String +document +literal + + + + + +Method for setting 'Text' property. + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +OnChange + + +OnMessage + + +Type + + +MaxVal + + +MinVal + + +MaxLen + + +MinLen + + +CheckMaxLen + + +CheckMinLen + + +CheckMaxVal + + +CheckMinVal + + +CommaDelimiter + + +Pattern + + +lbNavigationKeys + + +Scale + + +ShowMessages + + +UserDefinedSet + + +MaxValIsAllowed + + +MinValIsAllowed + + +ChangeToMaxVal + + +ChangeToMinVal + + +ChangeToMaxLen + + +ChangeToType + + +PatternHelpStr + + +HelpStr + + +CheckScale + + +OnValidate + + +FMsgHint + + +MinimumHintWidth + + +LastMO + + +HintParent + + +FHintLeftOffset + + +FHintParent + + +FHintTopOffset + + +OnValidateValue + + +ValidateKeyIsActive + + +ValidateKeyEventIsActive + + +OnValidateKey + + +FRawText + + +AdvancedORefType + + +ErrorColor + + +ErrorFontColor + + +FBaseColor + + +FBaseFontColor + + +OnKeyPressEventIsActive + + +OnExitEventIsActive + + +CheckOnTextSet + + +ValidateTextSet + + +lbAllowedKeys + + + + + Index: UI/Lib/Ctrl/THint.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/THint.cls.xml (revision 0) +++ UI/Lib/Ctrl/THint.cls.xml (revision 61) @@ -0,0 +1,717 @@ + + + +serial +%Const,MakovaDrawTextCnts +Default +%Library.TMPanel + + +%Library.Integer +14996172 + + + +%Library.Integer +10252916 + + + +%Library.Boolean +0 + + + +%Library.TMBitmap + + + +%Library.TMSpeedButton + + + +%Library.TMIcon + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.TMPaintBox + + + +%Library.Integer +20 + + + +%Library.String +200 + + + +%Library.String +$$$clBlack + + + +%Library.String +$$$clBlack + + + +%Library.List + + + +%Library.Integer + + + +%Library.Boolean +1 + + + +%Library.Integer +0 + + + +%Library.Boolean +1 + + + + +For internal use. + +generator +initvalue:%String +0 +%Library.Status + + + + +0 + + + + +Args:%String +0 + + + + +Value:%Boolean +0 +%Library.Status + + + + +From,To:%TMFont +0 + + + + +Args:%String +0 + + + + +Args:%Library.List +cache +0 +document +literal + + + + +Event:%Library.String,Args:%Library.List +cache +0 +document +literal + + + + + +Method for setting 'Height' property. + +Value:%Integer +0 +%Library.Status + + + + +0 + + + + +Value:%String +0 +%Library.Status + + + + +MsgType,MsgHeader,MsgTxt:%String="" +0 + + + + + +Method for setting 'Width' property. + +Value:%Integer +0 +%Library.Status + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +Alignment + + +BorderStyle + + +FullRepaint + + +Locked + + +PropName + + +FBitmapCopy + + +FPaintBox + + +BackgroundColor + + +BorderColor + + +LeftOffset + + +MsgHeaderFont + + +MsgTxtFont + + +PositioningControl + + +ShowIcons + + +TopOffset + + +UsePositioningControl + + +FIcon + + +FLastMsgHeader + + +FLastMsgTxt + + +FLastMsgType + + +MsgHeaderColor + + +MsgTxtColor + + +MinimumHintWidth + + +CloseButton + + +FButtonClose + + +OnCloseBtnClick + + + + + Index: UI/Lib/Ctrl/TDirTree.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TDirTree.cls.xml (revision 0) +++ UI/Lib/Ctrl/TDirTree.cls.xml (revision 61) @@ -0,0 +1,221 @@ + + + +serial +%Const +Default +%TMOleContainer + + + +For internal use. + +%Library.TMOleObject + + + +%Library.String + + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +Value:%Library.Integer +cache +0 +%Library.Status +document +literal + + + + +"\\notes01\\shared\common\stv.ocx" + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ObjectVerbs + + +OnActivate + + +OnDeactivate + + +OnObjectMove + + +FShellObj + + +Path + + + + + Index: UI/Lib/Dlg/TPickLevFromListOld.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickLevFromListOld.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickLevFromListOld.cls.xml (revision 61) @@ -0,0 +1,566 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 +0 Do + . Set ..lbLeveranciers.ItemIndex=0 + + Quit + + //----------------------------------------------------------------------------- + //----------------------------------------------------------------------------- + //----------------------------------------------------------------------------- + // SQL WAY - Not yet implemented + Quit + //----------------------------------------------------------------------------- + Quit:(..txtNaamNummer.Text="") + + Do ..lbLeveranciers.Clear() + + Set ..lbLeveranciers.Visible="False" + If $IsValidNum(..txtNaamNummer.Text) Do + . Do LeverancierViaNummer(..txtNaamNummer.Text) + Else Do + . Do LeverancierViaNaam(..txtNaamNummer.Text) + Set ..lbLeveranciers.Visible="True" + Set ..Form.Caption="Selecteer leverancier: "_ ..lbLeveranciers.Items.Count _ " gevonden." + + Quit + +LeverancierViaNummer(Nummer) + Set Nummer=$TR(Nummer,"*","%") + Set Nummer=$TR(Nummer,"?","_") + + Set result=##class(%ResultSet).%New("%DynamicQuery:SQL") + Do result.Prepare("SELECT ID,Naam FROM Derde_Lev.Lev WHERE Nummer="_Nummer) + Do result.Execute() + For Quit:'result.Next() Do + . Do ..lbLeveranciers.Items.AddObject(result.Get("Naam"),result.Get("ID")) + Do result.%Close() + + Quit + +LeverancierViaNaam(Naam) + Set Naam=$ZCVT(Naam,"U") + Set Naam=$TR(Naam,"*","%") + Set Naam=$TR(Naam,"?","_") + + Set result=##class(%ResultSet).%New("%DynamicQuery:SQL") + Do result.Prepare("SELECT ID,Naam FROM Derde_Lev.Lev WHERE UPPER(Naam) LIKE '"_Naam_"'") + Do result.Execute() + For Quit:'result.Next() Do + . Do ..lbLeveranciers.Items.AddObject(result.Get("Naam"),result.Get("ID")) + Do result.%Close() + + Quit + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +lbSortList + + +lbKlanten + + +Bevel2 + + +Label1 + + +txtNaamNummer + + +lbLeveranciers + + + + + Index: UI/Res/Vertaling/dlgDetailLink.cls.xml =================================================================== diff -u --- UI/Res/Vertaling/dlgDetailLink.cls.xml (revision 0) +++ UI/Res/Vertaling/dlgDetailLink.cls.xml (revision 61) @@ -0,0 +1,1443 @@ + + + +serial +ReportErrorCNTs,DetailVertalingAbstractCNTs,KeyCodesCNTs +Default +%Library.TMFormClass + + +%Library.String + + + + +Aangezien het OnDestroy event van DesignForm ten huidige +tijde nog niet geïmplementeerd is, is deze boolean een noodzaak. +Wanneer False, dan wordt TaalObj e.d. niet afgesloten, anders wel... + +%Library.Boolean +"False" + + + +%Library.TMForm + + + +%TMGroupBox + + + +%Library.Boolean +0 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMGroupBox + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMScrollBox + + + +%TMEdit + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal +Combo rest + + Quit + +]]> + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +Groep,Intern,VertalingsType:%String +cache +0 +document +literal +display + //Error handling voor LinkObj van daarnet + If LinkObject=$$$NULLOREF Do ..ReportError($$$reCannotCreateNewObj,"Res.VertalingLink") Quit + + New tmpMemo + For Quit:'RS.Next() Do // QUERY START ---------< + . Set LinkObj(RS.Get("Taal"),$$$loDirectoryCombo).Text=RS.Get("DirectoryCode") + . Set LinkObj(RS.Get("Taal"),$$$loPlaatsCombo).Text=LinkObject.WebPlaatsingLogicalToDisplay(RS.Get("WebPlaatsing")) + . Set LinkObj(RS.Get("Taal"),$$$loSoortCombo).Text=LinkObject.SoortLogicalToDisplay(RS.Get("Soort")) + . Set LinkObj(RS.Get("Taal"),$$$loURLCombo).Text=RS.Get("Vertaling") + . Set LinkObj(RS.Get("Taal"),$$$loExtensionCombo).Text=RS.Get("Extensie") + . If RS.Get("Taal")=..#DefaultTaal Do + .. Set ..chkTaalAfhankelijk.Checked=$S(RS.Get("TaalAfhankelijk")=1:"True",1:"False") + .. Set ..chkTaalAfhankelijk.Tag=..chkTaalAfhankelijk.Checked + + //NB TaalAfh: in de tag wordt de oospronkelijke waarde onthouden, deze waarde wordt gebruikt + // bij de SaveVertaling method + + Do LinkObject.%Close() + Do RS.%Close() // QUERY STOP ---------< + + Quit + + + +]]> + + + +Groep:%String +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +TaalAfhankelijk:%Boolean +cache +0 +document +literal + + + + +ErrorType:%Integer,Msg:%String="",Silent:%Boolean="False",MsgBoxType=0 +cache +0 +document +literal + + + + +cache +0 +%Library.Boolean +document +literal + + + + +VertalingsType +cache +0 +document +literal + + + + +TaalID:%Library.String +cache +0 +document +literal + + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal +lock niet gelukt! + + If LockGranted="False" Do + . Do MApplication.MessageBox("De geselecteerde vertaling wordt momenteel aangepast, probeer later opnieuw.","VAN HOECKE",$$$MBICONINFORMATION) + + Quit LockGranted + +]]> + + + +Groep,Intern,Type,Taal:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal +0) ..cbbVertalingsType.ItemIndex=0 + + Quit + + //----------------------------------------------------------------------------- +AddToTypePump(ToList,Value,Object) + Do ToList.Items.Add(Object_": "_Value) + Quit + +]]> + + + +N + + + +%Library.CacheSerialState + +list +"%Library.TMFormClass" + +Address + + +Form + + +ComboBox1 + + +Edit1 + + +GroupBox1 + + +GroupBox2 + + +Image1 + + +Label1 + + +Label2 + + +Label3 + + +Memo1 + + +Memo2 + + +Memo3 + + +SpeedButton1 + + +SpeedButton2 + + +Button1 + + +PaintBox1 + + +ScrollBox1 + + +btnAnnuleren + + +btnOk + + +cbbVertalingsType + + +gbVertalingen + + +txtIntern + + +sbVertalingen + + +CurrentGroep + + +FinalClose + + +CheckBox1 + + +lblDirectory + + +lblExt + + +lblLinks + + +lblPlaats + + +lblSoort + + +lblURL + + +chkTaalAfhankelijk + + +btnCopyDefault + + +IsNewTranslation + + +btnDefaultOL + + +chkLoadUrls + + +btnOkAndNext + + + + + Index: UI/Lib/Dlg/TStatPeriode.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TStatPeriode.cls.xml (revision 0) +++ UI/Lib/Dlg/TStatPeriode.cls.xml (revision 61) @@ -0,0 +1,1693 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +STRING +0 +Default +%Library.TMFormClass +0 + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.Boolean +0 +0 + +0 +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMComboBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +$LB("Januari","Februari","Maart","April","Mei","Juni","Juli","Augustus","September","Oktober","November","December") +0 +0 +0 +0 +0 + + + + +Bij opstarten wordt dit ingevuld, naargelang de inhoud van cntMonths +%Library.String +0 +0 + +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPanel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPanel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPanel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMShape +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMShape +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMShape +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMShape +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMShape +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Delta:%Integer +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Library.Status +0 +'Januari 2002', afhankelijk van opgegeven $H en ..cntMonthsAsStr + ;------------------------------------------------------------------------------ + #Define ConvHToDate(%H) $P($ZDATE(%H,2,..cntMonthsAsStr)," ",2,3) + + ;---=[ Default CumulatieType ]=--- + Set ..cbbCumulatieType.ItemIndex=0 + + ;---=[ cntMonths->cntMonthsAsStr ]=--- + ;Wordt gebruikt bij $ZDATEH (MonthList) + Set ..cntMonthsAsStr="" + New Loop + For Loop=1:1:12 Do + . Set ..cntMonthsAsStr=..cntMonthsAsStr_" "_$LI(..cntMonths,Loop) + + ;---=[ Startdatum instellen op 'nu' ]=--- + ;Do ..SetHuidigeDatum($H) + + q $$$OK + +]]> + + + +0 +0 +code +H:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 +'Januari 2002', afhankelijk van opgegeven $H en ..cntMonthsAsStr + ;------------------------------------------------------------------------------ + #Define ConvHToDate(%H) $P($ZDATE(%H,2,..cntMonthsAsStr)," ",2,3) + + ;------------------------------------------------------------------------------ + ; CALC DATES + ;------------------------------------------------------------------------------ + ; Maand + If ..cbbCumulatieType.ItemIndex=0 Do + . Set (..BeginVan,..BeginTot)=HuidigeDatumToH + . Set (..EindeVan,..EindeTot)=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-12,"MD") + + ; Boekjaar lopend boekjaar tov volledig vorig boekjaar + If ..cbbCumulatieType.ItemIndex=1 Do + . Set ..BeginVan=$$CALCDATE^vhDTyp($$CALCDATE^vhDTyp(HuidigeDatumToH,"BJ","FD"),"M") + . Set ..BeginTot=HuidigeDatumToH + . Set ..EindeVan=$$CALCDATE^vhDTyp($$CALCDATE^vhDTyp(HuidigeDatumToH,"BJ",-1,"FD"),"M") + . Set ..EindeTot=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-12,"MD") + + ; Cumul van 12 maanden tov vorig boekjaar + If ..cbbCumulatieType.ItemIndex=2 Do + . Set ..BeginTot=HuidigeDatumToH + . Set ..BeginVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-11,"MD") + . Set ..EindeVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"BJ",-1,"FD") + . Set ..EindeTot=$$CALCDATE^vhDTyp(HuidigeDatumToH,"BJ",-1,"LD") + + ; Cumul van 12 maanden tov 12 maanden ervoor + If ..cbbCumulatieType.ItemIndex=3 Do + . Set ..BeginTot=HuidigeDatumToH + . Set ..BeginVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-11,"MD") + . Set ..EindeVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-23,"MD") + . Set ..EindeTot=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-12,"MD") + + ; Cumul van 12 maanden tov 1 maand ervoor + If ..cbbCumulatieType.ItemIndex=4 Do + . Set ..BeginTot=HuidigeDatumToH + . Set ..BeginVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-11,"MD") + . Set ..EindeVan=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-12,"MD") + . Set ..EindeTot=$$CALCDATE^vhDTyp(HuidigeDatumToH,"M",-1,"MD") + + ;------------------------------------------------------------------------------ + ; INVULLEN IN LABELs + ;------------------------------------------------------------------------------ + Set ..lblBeginVan.Caption=$$$ConvHToDate(..BeginVan) + Set ..lblBeginTot.Caption=$$$ConvHToDate(..BeginTot) + Set ..lblEindeVan.Caption=$$$ConvHToDate(..EindeVan) + Set ..lblEindeTot.Caption=$$$ConvHToDate(..EindeTot) + + Quit + + + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +listnode +"%Library.TMFormClass" + +Address + + +Form + + +ComboBox1 + + +GroupBox5 + + +Label15 + + +Label3 + + +Shape2 + + +btnDecMaand + + +btnIncMaand + + +editHuidigeDatum + + +Label16 + + +Label17 + + +Label18 + + +Label19 + + +Label20 + + +Label21 + + +Panel1 + + +Panel2 + + +Shape3 + + +Shape4 + + +ComboBox2 + + +Edit1 + + +Label22 + + +Label23 + + +Panel3 + + +Shape5 + + +Shape6 + + +Button1 + + +btnNavHuidigeDatum + + +cbbCumulatieType + + +txtHuidigeDatum + + +Button2 + + +BtnIsDown + + +SpeedButton1 + + +SpeedButton2 + + +pnlHeader + + +pnlHuidigeDatum + + +pnlReferentieDatum + + +shBack + + +shHeader + + +shHuidigeDatum + + +shReferentieDatum + + +XOffs + + +YOffs + + +IsInMove + + +Shape1 + + +btnNextHuidigeDatum + + +btnPrevHuidigeDatum + + +tmrBtnClickRepeat + + +BtnToRepeat + + +btnAnnuleren + + +btnOk + + +shButtons + + +Months + + +cntMonths + + +Label24 + + +Label25 + + +Label26 + + +Label27 + + +lblBeginTot + + +lblBeginVan + + +lblEindeTot + + +lblEindeVan + + +cntMonthsToStr + + +cntMonthsAsStr + + +btnHuidigeDatumNu + + +BeginTot + + +BeginVan + + +EindeTot + + +EindeVan + + + + + Index: UI/Lib/Dlg/TPickRekeningFromList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickRekeningFromList.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickRekeningFromList.cls.xml (revision 61) @@ -0,0 +1,615 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs,ReportErrorCNTs +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code +ErrorType:%Integer,Msg:%String="",MsgBoxType=0 +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 +0 Do + . Set ..lbRekeningen.ItemIndex=0 + + Quit + //----------------------------------------------------------------------------- +RekeningViaNr(Nummer) + Set Nummer=$$WildCardToPattern^vhLib(Nummer) + New NrLoop + Set NrLoop="" + For Set NrLoop=$O(plRekeningNrs(NrLoop)) Quit:(NrLoop="") Do + . Do:(NrLoop?@Nummer) ..lbRekeningen.Items.AddObject(NrLoop_" "_plRekeningNrs(NrLoop),NrLoop) + + Quit + +RekeningViaNaam(Naam) + Set Naam=$ZCVT($$WildCardToPattern^vhLib(Naam),"U") + New NrLoop,RekOmsch + Set NrLoop="" + For Set NrLoop=$O(plRekeningNrs(NrLoop)) Quit:(NrLoop="") Do + . Do:(plRekeningNrs(NrLoop)?@Naam) ..lbRekeningen.Items.AddObject(NrLoop_" "_plRekeningNrs(NrLoop),NrLoop) + + Quit + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +lbSortList + + +lbKlanten + + +Bevel2 + + +Label1 + + +txtNaamNummer + + +txtGroepNummer + + +lbRekeningen + + + + + Index: UI/Lib/Ctrl/TListBox.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TListBox.cls.xml (revision 0) +++ UI/Lib/Ctrl/TListBox.cls.xml (revision 61) @@ -0,0 +1,427 @@ + + + +serial +%Const,KeyCodesCNTs,UILibCtrlCNTs +Default +%Library.TMListBox + + + +Contains oref of the %TMString object containing list of radio buttons names. + +%VHSys.Lib.TMStrings + + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnAfterFillItems=$lb(%this,"cboExampleOnAfterFillItems")
    +]]>     +%Library.String +     + + + +Geeft als argumenten terug: $LB(Sender)

    + +Te plaatsen in de OnCreate() method van de FormClass: 
    +Set ..cboExample.OnBeforeFillItems=$lb(%this,"cboExampleOnBeforeFillItems")
    +]]>     +%Library.String +     + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + + +Wist alle Items (keys en text) in de ComboBox. + +cache +0 +document +literal + + + + + +Kopieert alle Items van één TRadioGroup (FromRadioG) naar deze TRadioGroup. Als de parameter SetSelected=1, dan wordt ook het geselecteerde item van FromRadioG overgenomen + +FromListBox:UI.Lib.Ctrl.TListBox,SetSelected:%Boolean=0 +cache +0 +document +literal + + + + +Event:%String,Args:%String="" +cache +0 +document +literal + + + + + ResetItem )
    +Verdere uitleg: zie method SetTextItems() van de klasse +VHSys.Lib.TMStrings
    +]]>     +Text:%String,Keys:%List,ResetItem:%Integer,CheckFlags:%Integer,RemoveFlags:%Integer +cache +0 +%Library.String +document +literal + +     + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Index:%Integer +cache +0 +document +literal + + + + +Key:%String +cache +0 +document +literal + + + + +Text:%String +cache +0 +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + + +SetIndex() is 100% gelijk aan SelectByIndex() + +Index:%Integer +cache +0 +document +literal + + + + +%Library.CacheSerialState + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +Brush + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +Items + + +OnAfterFillItems + + +OnBeforeFillItems + + +Items2 + + +Query + + +Canvas + + +OnDrawItem + + +OnMeasureItem + + + +     +     Index: UI/Lib/Dlg/ListSort.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/ListSort.cls.xml (revision 0) +++ UI/Lib/Dlg/ListSort.cls.xml (revision 61) @@ -0,0 +1,629 @@ + + + +serial +KeyCodesCNTs +Default +%Library.TMFormClass +0 + + +%TMSpeedButton + + + +%TMBevel + + + +%Library.Boolean +"False" + + + +%Library.TMForm + + + +%Library.String +-1 + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMListBox + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +%Library.String +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +List:%String +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal +(..lbSortList.Items.Count-2)) //laatste uit lijst (kan niet down) + + Do ..lbSortList.Items.Exchange(..lbSortList.ItemIndex,..lbSortList.ItemIndex+1) + Set ..lbSortList.ItemIndex=..lbSortList.ItemIndex+1 + + ;End of user code + s Args=$lb(Sender) + q +]]> + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +btnSortDown + + +btnSortUp + + +lbSortList + + +Dragging + + +OldIndex + + +SpeedButton1 + + +btnSortAlpha + + +btnSortAlphaNum + + +btnDefault + + +btnAdvancedSort + + +rMetaGroep + + +rKenmerkToSort + + + + + Index: UI/Lib/Dlg/TCheckListBox.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TCheckListBox.cls.xml (revision 0) +++ UI/Lib/Dlg/TCheckListBox.cls.xml (revision 61) @@ -0,0 +1,428 @@ + + + +serial +KeyCodesCNTs +Default +%Library.TMFormClass + + +%Library.TMForm + + + +%Library.Integer +1 + + + +%TMShape + + + +%TMShape + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMCheckListBox + + + +%TMPopupMenu + + + +%TMMenuItem + + + +%TMMenuItem + + + +initvalue:%String +0 +%Status + + + + +0 + + + + +Args:%String +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication + + + + +initvalue:%String +0 +%Status + + + + +MinFormHeight:%Integer=100,MaxFormHeight:%Integer=476 +0 +MinFormHeight Do + . Set NewFormHeight=MinFormHeight + Else If NewFormHeight' + + + +Select:%Boolean="True" +0 + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +0 +%Library.Boolean + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +Button1 + + +Button2 + + +CheckListBox1 + + +Bevel1 + + +btnCancel + + +btnOk + + +clbItems + + +bvlMain + + +Shape1 + + +Shape2 + + +SpeedButton1 + + +SpeedButton2 + + +MinimumCheckCnt + + +pmItems + + +pmiDeselectAll + + +pmiSelectAll + + + + + Index: UI/Lib/Dlg/TViewImage.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TViewImage.cls.xml (revision 0) +++ UI/Lib/Dlg/TViewImage.cls.xml (revision 61) @@ -0,0 +1,594 @@ + + + +serial +%Library.TMFormClass + + +%Library.TMForm + + + +%TMMenuItem + + + +%TMButton + + + +%TMButton + + + +%TMCheckBox + + + +%TMImage + + + +%TMOpenDialog + + + +%Library.String + + + +%Library.String + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%TMPopupMenu + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMMenuItem + + + +%TMScrollBox + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +FileName:%String +cache +0 +%Library.Boolean +document +literal + + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +FitToWindow:%Boolean +cache +0 +document +literal +sbWidth) || (..pOrigHeight>sbHeight) Do + . Set Ratio=(sbHeight/..pOrigHeight) + . If (Ratio*..pOrigWidth)>sbWidth Do + .. Set Ratio=(sbWidth/..pOrigWidth) + .. Set CenterWidth=0,CenterHeight=1 + . Else Do + .. Set CenterWidth=1,CenterHeight=0 + . If FitToWindow Do + .. Set ..imImage.AutoSize="False" + .. Set ..imImage.Height=(..pOrigHeight*Ratio)\1 + .. Set ..imImage.Width=(..pOrigWidth*Ratio)\1 + .. Set ..imImage.Stretch="True" + . Else Do + .. Set ..imImage.AutoSize="True" + .. Set ..imImage.Height=..pOrigHeight + .. Set ..imImage.Width=..pOrigWidth + .. Set ..imImage.Stretch="False" + .. Set CenterWidth=(..pOrigWidth'>sbWidth) + .. Set CenterHeight=(..pOrigHeight'>sbHeight) + Else Do + . Set (CenterWidth,CenterHeight)=1 + . Set ..imImage.Height=..pOrigHeight + . Set ..imImage.Width=..pOrigWidth + . Set ..imImage.Stretch="False" + + Set ..imImage.Left=$S(CenterWidth:(sbWidth-..imImage.Width)\2,1:0) + Set ..imImage.Top=$S(CenterHeight:(sbHeight-..imImage.Height)\2,1:0) + + Quit +]]> + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +btnClose + + +btnOpen + + +imImage + + +sbImage + + +pOrigHeight + + +pOrigWidth + + +CheckBox1 + + +chkFitToWindow + + +odOpen + + +pFileName + + +pmImage + + +pmiCopyFileName + + +pmiCopyPathAndFileName + + +pOrigCaption + + +MenuItem1 + + +pmiOpen + + + + + Index: UI/Lib/Dlg/TPrintPreview.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPrintPreview.cls.xml (revision 0) +++ UI/Lib/Dlg/TPrintPreview.cls.xml (revision 61) @@ -0,0 +1,1037 @@ + + + +0 +0 +serial +0 +TGrid +MakovaDrawTextCnts +STRING +0 +Default +%Library.TMFormClass +0 + + +%Library.TMBitmap +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.TMBitmap +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.TMPrinter +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +0 +0 +0 +0 +0 + + + +%TMStatusBar +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.Float +0 +0 + +1/10 +0 +0 +0 +0 +0 + + + +%Library.Float +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Float +0 +0 + +0 +0 +0 +0 +0 + + + +%Library.Float +0 +0 + +3/2 +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPaintBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMPanel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +200 +0 +0 +0 +0 +0 + + + +%Library.Integer +0 +0 + +200 +0 +0 +0 +0 +0 + + + +%TMPrinterSetupDialog +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMScrollBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +%Library.Integer +0 + + + + +0 +0 +code + +0 +%Library.Float +0 + + + + +0 +0 +code + +0 +%Library.Float +0 + + + + +0 +0 +code + +0 +0 + + ; SimplePanel = False + ; end + ; object psdChoose: CPrinterSetupDialog + ; Left = 355 + ; Top = 7 + ; end + ;end + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code +Value:%Integer +0 +%Library.Status +0 +..ZoomMax) $$$OK + + If (Value/..ZoomStep)<..ZoomMin Do + . Set ..btnZoomOut.Enabled="False" + Else Do + . Set ..btnZoomOut.Enabled="True" + + If (Value*..ZoomStep>..ZoomMax) Do + . Set ..btnZoomIn.Enabled="False" + Else Do + . Set ..btnZoomIn.Enabled="True" + + Set i%ZoomFactor=Value + Set ..PrintFactor=Value*8 + + Quit $$$OK + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Grid:UI.Lib.Ctrl.TGrid +0 +0 + + + + +0 +0 +code + +0 +0 +..FPrinter.PageHeight Do + . Set ..ZoomMax=3000/..FPrinter.PageWidth + . Set ..ZoomMin=100/..FPrinter.PageWidth + Else Do + . Set ..ZoomMax=3000/..FPrinter.PageHeight + . Set ..ZoomMin=100/..FPrinter.PageHeight + + Set ..FBMPPreview.Canvas.Brush.Color=$$$clWhite + Do ..FBMPPreview.Canvas.FillRect($LB(0,0,..FBMPPreview.Width,..FBMPPreview.Height)) + + Set ..FBMPContents.Canvas.Brush.Color=$$$clWhite + Do ..FBMPContents.Canvas.FillRect($LB(0,0,..FBMPContents.Width,..FBMPContents.Height)) + + Set ..FBMPPreview.Canvas.Brush.Color=$$$clBlack + Do ..FBMPPreview.Canvas.FrameRect($LB(0,0,..FBMPPreview.Width,..FBMPPreview.Height)) + + Set ..pbPreview.Left=0 + Set ..pbPreview.Top=0 + Set ..pbPreview.Width=..FBMPPreview.Width+50 + Set ..pbPreview.Height=..FBMPPreview.Height+50 + + Do:(..OnDrawPreview'="") MApplication.HandleEvent($LI(..OnDrawPreview,1),$LI(..OnDrawPreview,2),"") + + Set MApplication.ScreenCursor=$$$crDefault + + Quit + +]]> + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +listnode +"%Library.TMFormClass" + +Address + + +Form + + +pnlNav + + +sbPreview + + +PaintBox1 + + +pbPreview + + +FBMPPreview + + +FPrinter + + +ZoomFactor + + +btnZoomIn + + +btnZoomOut + + +FitPageWidthFactor + + +btnFitPageWidth + + +btnWholePage + + +btnSetupPage + + +psdChoose + + +btnFitPageHeight + + +ZoomMax + + +ZoomMin + + +ZoomStep + + +chkMonochroom + + +OnDrawPreview + + +prLeftBorder + + +prTopBorder + + +FBMPContents + + +PrintFactor + + +pbProgress + + +StatusBar1 + + + + + Index: UI/Lib/Dlg/TListView.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TListView.cls.xml (revision 0) +++ UI/Lib/Dlg/TListView.cls.xml (revision 61) @@ -0,0 +1,259 @@ + + + +serial +Default +%Library.TMFormClass +0 + + +%Library.TMForm + + + +%TMButton + + + +%TMButton + + + +%TMLabel + + + +%TMListView + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + ; HotTrackStyles = [] + ; TabOrder = 0 + ; ViewStyle = vsReport + ; ControlClass = 'UI.Lib.Ctrl.TSortableListView' + ; end + ; object btnAnnuleren: CButton + ; Left = 260 + ; Top = 237 + ; Width = 75 + ; Height = 25 + ; Anchors = [akRight, akBottom] + ; Caption = '&Annuleren' + ; TabOrder = 1 + ; OnClick = btnAnnulerenClick + ; end + ; object btnOk: CButton + ; Left = 180 + ; Top = 237 + ; Width = 75 + ; Height = 25 + ; Anchors = [akRight, akBottom] + ; Caption = '&Ok' + ; TabOrder = 2 + ; OnClick = btnOkClick + ; end + ;end +]]> + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +0 + + + +1 + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +btnAnnuleren + + +btnOk + + +lvItems + + +lblMessage + + +SortColumnIndex + + +ilDownUp + + +SortDirection + + +Button1 + + +lvCanvas + + +CanvasOK + + + + + Index: UI/Lib/Dlg/DrawFlags.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/DrawFlags.cls.xml (revision 0) +++ UI/Lib/Dlg/DrawFlags.cls.xml (revision 61) @@ -0,0 +1,1225 @@ + + + +serial +MakovaDrawTextCnts,TTreeViewExCNTs +Default +%Library.TMFormClass + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.TMForm + + + +%TMGroupBox + + + +%TMGroupBox + + + +%TMGroupBox + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMLabel + + + +%TMButton + + + +%TMButton + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMCheckBox + + + +%TMLabel + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +%TMRadioButton + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +GroupBox1 + + +RadioButton1 + + +RadioButton2 + + +RadioButton3 + + +RadioButton4 + + +RadioButton5 + + +RadioButton6 + + +RadioButton7 + + +RadioButton8 + + +RadioButton9 + + +GroupBox2 + + +Label1 + + +Label2 + + +RadioButton10 + + +RadioButton11 + + +GroupBox3 + + +CheckBox1 + + +CheckBox2 + + +CheckBox3 + + +Label3 + + +Label4 + + +Label5 + + +CheckBox4 + + +Label6 + + +RadioButton12 + + +RadioButton13 + + +Label10 + + +Label7 + + +Label8 + + +Label9 + + +Button1 + + +Button2 + + +btnAnnuleren + + +btnOk + + +chkEllipsis + + +chkExpandTabs + + +chkNoClipping + + +chkNoPrefix + + +rbBottomCenter + + +rbBottomLeft + + +rbBottomRight + + +rbBreakWords + + +rbCenterCenter + + +rbCenterLeft + + +rbCenterRight + + +rbEllipsisEnd + + +rbEllipsisMiddle + + +rbSingleLine + + +rbTopCenter + + +rbTopLeft + + +rbTopRight + + +lblEllipsis + + +rbDefaultLine + + +DrawingFlags + + +FColID + + +FProgram + + +FRowID + + + + + Index: UI/Lib/Dlg/TPickProdFromList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickProdFromList.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickProdFromList.cls.xml (revision 61) @@ -0,0 +1,507 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +STRING +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +LookUpStr:%String +0 +%Library.Integer +0 + + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 +0 Do + .. Do ..lbProducten.SetFocus() + .. Set ..lbProducten.ItemIndex=0 + . Else Do + .. Do ..txtProductInput.SelectAll() + + ;End of user code + s Args=$lb(Sender,Key,Shift) + q + +]]> + + + +%Library.CacheSerialState + +list +"%Library.TMFormClass" + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +lbSortList + + +lbKlanten + + +Bevel2 + + +Label1 + + +txtNaamNummer + + +lbProducten + + +txtProductInput + + + + + Index: UI/Lib/Dlg/TTExNodeDtls.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TTExNodeDtls.cls.xml (revision 0) +++ UI/Lib/Dlg/TTExNodeDtls.cls.xml (revision 61) @@ -0,0 +1,233 @@ + + + +0 +0 +serial +0 +STRING +0 +%Library.TMFormClass +0 + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListView +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + ; HotTrackStyles = [] + ; ReadOnly = True + ; RowSelect = True + ; TabOrder = 0 + ; ViewStyle = vsReport + ; end + ; object btnClose: CButton + ; Left = 489 + ; Top = 296 + ; Width = 75 + ; Height = 25 + ; Anchors = [akRight, akBottom] + ; Cancel = True + ; Caption = 'Close' + ; TabOrder = 1 + ; OnClick = btnCloseClick + ; end + ;end + +]]> + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +listnode +"%Library.TMFormClass" + +Address + + +Form + + +btnClose + + +lvNodeDtls + + + + + Index: UI/Lib/Ctrl/TDAComboBox.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TDAComboBox.cls.xml (revision 0) +++ UI/Lib/Ctrl/TDAComboBox.cls.xml (revision 61) @@ -0,0 +1,1231 @@ + + + +serial +%Const +Default +%Library.TMComboBox + + + +
  • csAlpha: Matches any of the 52 ASCII upper- and lower-case alphabetic characters (that is, A through Z and a through z) +
  • csLowerCase: Matches any of the 26 ASCII lower-case alphabetic characters (that is, a through z," "). +
  • csLowerCaseAC: Matches any of the 26 ASCII lower-case alphabetic characters (that is, a through z," "), autoconvert uppercases. +
  • csUpperCase: Matches any of the 26 ASCII upper-case alphabetic characters (that is, A through Z," "). +
  • csUpperCaseAC: Matches any of the 26 ASCII upper-case alphabetic characters (that is, A through Z," "), autoconvert lowercases.. +
  • csAll: Matches any of the characters in the printable ASCII character set (ASCII codes 0 through 255). +
  • csInteger: Matches any of the 10 ASCII numeric characters (that is, 0 through 9). +
  • csFloat: Matches any of the 10 ASCII numeric characters (that is, 0 through 9)+ CommaDelimiter (default ".") (Set scale for number of digits). +
  • csUserDefined: Matches any of the ASCII characters specified in UserDefinedCharSet + + +PS: Property "RawAllowedCharSet" can be used for TAB, ... +]]> +%Library.String +"csAll" + + + + +%Library.String +$$$clWhite + + + +%Library.String +$$$clBlack + + + +%Library.String +"." + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.String +$$$clRed + + + +%Library.String +$$$clYellow + + + +%Library.String + + + +%Library.String + + + +%Library.String + + + +%Library.Integer +0 + + + +%Library.Integer +0 + + + +%Library.String +"?" + + + +%Library.Integer +0 + + + +%Library.String + + + +%Library.String + + + + +Default: Tab (8) + +%Library.String +$C(8,9,10,13,27) + + + +%Library.Integer +0 + + + +%Library.Boolean +1 + + + +%Library.String + + + + +%Library.String + + + + +For internal use. + +generator +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +Value:%String +cache +0 +document +literal + + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal +..Scale Do + .. Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Cijferbeperking","Het aantal cijfers achter de komma is beperkt tot "_ ..Scale _" voor het veld '" _ ..CoupledProperty _ "'.")) + .. Do ..SetFocus() + .. Set ..SelStart=$Find(Value,..CommaDelimiter) //Overbodige digits selecteren, de gebruiker hoeft enkel DEL in te drukken + .. Set ..SelLength=DotLength + .. Set Error=1 + + //MinLen + If ..MinLen If $L(Value)<..MinLen Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Minimum lengte","De minimum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MinLen _" karakter(s).")) + . Do ..ReFocusAndSelect() + . Set Error=1 + + //MinLen + If ..MaxLen If $L(Value)>..MaxLen Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Maximum lengte","De maximum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxLen _" karakter(s).")) + . Do ..SetFocus() + . Set ..SelStart=..MaxLen //Overbodige tekens selecteren, de gebruiker hoeft enkel DEL in te drukken + . Set ..SelLength=$L(Value)-..MaxLen + . Set Error=1 + + //Data - aware + If (..FOldValue'=Value) && 'Error Do //Geen fout, eventueel gekoppeld object bijwerken + . If (..FCoupledORef) && (..CoupledProperty'="") Do + .. Do ..FAssignValue(Value) + + Set ..FOldValue=Value + + ;End of user code + s Args=$lb(Sender) + q + +]]> + + + +Args:%String +cache +0 +document +literal +64) && ($ASCII(Key)<91) Do + .. Set Key=$C($ASCII(Key)+32) + . Else If Key'?1(1L,1" ") Set InSet=0 + Else If ..AllowedCharSet="csUpperCase" Set:(Key'?1(1U,1" ")) InSet=0 //csUpperCase + Else If ..AllowedCharSet="csUpperCaseAC" Do //csUpperCaseAC + . If ($ASCII(Key)>96) && ($ASCII(Key)<123) Do + .. Set Key=$C($ASCII(Key)-32) + . Else If Key'?1(1U,1" ") Set InSet=0 + Else If ..AllowedCharSet="csAll" Set:(Key'?1E) InSet=0 //csAll + Else If ..AllowedCharSet="csInteger" Set:(Key'?0.1"-".N) InSet=0 //csNumeric + Else If ..AllowedCharSet="csFloat" Do //csFloatNumeric + . If (Key'=..CommaDelimiter) Set:(Key'?0.1"-".N) InSet=0 //Geen komma, set error wanneer ook geen cijfer + . Else Do + .. Set:($F(..Text,..CommaDelimiter)'=0) InSet=0 //Wel komma, geen error wanneer er nog geen komma in voorkomt + .. Set:(..Text="") InSet=0 //Wel komma, echter nog geen getallen ervoor + Else If ..AllowedCharSet="csUserDefined" Set:(..UserDefinedCharSet'[Key) InSet=0 //csUserDefined + + //Key in NavigatieSet of CharSet? Zoniet, negeer key dr gebruiker ingetoetst + If 'InRaw && 'InSet Do + . Do ..TriggerMessage($LB(%this,"moUser",$$$MBICONINFORMATION,"Keyboard input","De ingedrukte toets ' " _ Key _ " ' is niet geldig.")) + . Set Key=$C(0) + + ;End of user code + s Args=$lb(Sender,Key) + q + +]]> + + + + +Triggers just about nothing + +Value:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + + +Method for setting 'Text' property. + +Value:%String +cache +0 +%Library.Status +document +literal +..Scale Do + .. Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Cijferbeperking","Het aantal cijfers achter de komma is beperkt tot "_ ..Scale _" voor het veld '" _ ..CoupledProperty _ "'.")) + .. Set Value=$E(Value,$Find(Value,..CommaDelimiter)+Scale,99999) + + //MinLen + If ..MinLen If $L(Value)<..MinLen Do + . Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Minimum lengte","De minimum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MinLen _" karakter(s).")) + . New Loop,Min,Start + . Set Min=..MinLen,Start=$L(Value)+1 + . For Loop=Start:1:Min Set $E(Value,Loop)=..MinLenFillChar + + //MinLen + If ..MaxLen If $L(Value)>..MaxLen Do + . Do ..TriggerMessage($LB(%this,"moIntern",$$$MBICONINFORMATION,"Maximum lengte","De maximum lengte van het veld '" _ ..CoupledProperty _ "' is "_ ..MaxLen _" karakter(s).")) + . Set Value=$E(Value,1,..MaxLen) + + Do %this.SetProperty("Text",Value) + + q $$$OK + + + + +]]> + + + +Args:%String +cache +0 +document +literal + + + + +Value:%String +cache +0 +%Library.Status +document +literal + + + + +%Library.CacheSerialState +TDAComboBoxState + +list + +AllowedCharSet + + +BaseColor + + +BaseFontColor + + +CommaDelimiter + + +CoupledClassName + + +CoupledProperty + + +DisplayList + + +ErrorColor + + +ErrorFontColor + + +FCoupledORef + + +FOldValue + + +LastMO + + +MaxLen + + +MinLen + + +MinLenFillChar + + +MsgHint + + +OnMessage + + +Pattern + + +RawAllowedCharSet + + +Scale + + +ShowMessages + + +UserDefinedCharSet + + +ValueList + + +Address + + +Brush + + +Canvas + + +ClassName + + +CloseFromClient + + +Constraints + + +Font + + +Items + + +OnCanResize + + +OnChange + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDockDrop + + +OnDockOver + + +OnDragDrop + + +OnDragOver + + +OnDrawItem + + +OnDropDown + + +OnEndDock + + +OnEndDrag + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMeasureItem + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +Parent + + +PopupMenu + + +PropName + + +Query + + +Tag + + + + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +Align + + +Anchors + + +AutoSize + + +BiDiMode + + +Caption + + +ClientHeight + + +ClientWidth + + +Color + + +Constraints + + +Cursor + + +DockOrientation + + +DragCursor + + +DragKind + + +DragMode + + +Enabled + + +Font + + +Height + + +Hint + + +Left + + +Name + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +ParentBiDiMode + + +ParentColor + + +ParentFont + + +ParentShowHint + + +PopupMenu + + +ScalingFlags + + +ShowHint + + +Tag + + +Text + + +Top + + +Visible + + +Width + + +BevelEdges + + +BevelInner + + +BevelKind + + +BevelOuter + + +BevelWidth + + +BorderWidth + + +Brush + + +ControlCount + + +Ctl3D + + +DockSite + + +HelpContext + + +OnDockDrop + + +OnDockOver + + +OnEnter + + +OnExit + + +OnGetSiteInfo + + +OnKeyDown + + +OnKeyPress + + +OnKeyUp + + +OnMouseWheel + + +OnMouseWheelDown + + +OnMouseWheelUp + + +ParentCtl3D + + +TabOrder + + +TabStop + + +UseDockManager + + +WheelAccumulator + + +AutoSelect + + +BorderStyle + + +CanUndo + + +CharCase + + +HideSelection + + +MaxLength + + +Modified + + +OEMConvert + + +OnChange + + +PasswordChar + + +ReadOnly + + +SelLength + + +SelStart + + +SelText + + +PropName + + +CoupledORef + + +CoupledProperty + + +OnMessage + + +AllowedCharSet + + +UserDefinedCharSet + + +AllowedNavigationSet + + +CommaDelimiter + + +CoupledClassName + + +FCoupledORef + + +MaxLen + + +MinLen + + +MinLenFillChar + + +RawAllowedCharSet + + +FOldValue + + +Scale + + +Pattern + + +DisplayList + + +ValueList + + +Canvas + + +DropDownCount + + +DroppedDown + + +ItemHeight + + +ItemIndex + + +Items + + +OnDrawItem + + +OnDropDown + + +OnMeasureItem + + +Query + + +Sorted + + +Style + + +BaseColor + + +BaseFontColor + + +LastMO + + +ErrorColor + + +ErrorFontColor + + +MsgHint + + +ShowMessages + + + + + Index: UI/Lib/Dlg/TPickFromList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickFromList.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickFromList.cls.xml (revision 61) @@ -0,0 +1,566 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +0 +Default +%Library.TMFormClass +0 + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +"*" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +btnAnnuleren + + +btnOk + + +lblMessage + + +txtValue + + +ListBox1 + + +lbValues + + +btnFilter + + +LastFilter + + + + + Index: UI/Lib/Ctrl/TMsgLabel.cls.xml =================================================================== diff -u --- UI/Lib/Ctrl/TMsgLabel.cls.xml (revision 0) +++ UI/Lib/Ctrl/TMsgLabel.cls.xml (revision 61) @@ -0,0 +1,407 @@ + + + +0 +0 +serial +0 +%Const +STRING +0 +Default +%Library.TMLabel +0 + + +%Library.String +0 +0 + +1 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +1 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +0 +0 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +1 +0 +0 +0 +0 + + + +%Library.String +0 +0 + +1 +0 +0 +0 +0 + + + +%Library.TMTimer +0 +0 + +0 +0 +0 +0 +0 + + + + +For internal use. + +0 +0 +generator + +0 +%Library.Status +0 + + + + + +For internal use. + +0 +0 +generator +initvalue:%String +0 +%Library.Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code + +0 +0 +#push",..%ClassName(),$$$MBICONERROR) + + Set ..Visible=..FHistoryVisible(..FHistoryIndex) + Set ..Font.Color=..FHistoryFontColor(..FHistoryIndex) + + New Prefix + Set $P(Prefix," ",(..FHistoryIndex*2)-1)="" + If ..FHistoryIsTimed(..FHistoryIndex) Do + . ;Do WLFMT^vhDBG($G(Prefix)_"POP STATUS ["_..FHistoryIndex_"]: WAS TIMED","B") + . Do ..OnTimer($LB(%this)) + Else Do + . Set ..Caption=..FHistoryCaption(..FHistoryIndex) + . ;Do WLFMT^vhDBG($G(Prefix)_"POP STATUS ["_..FHistoryIndex_"]: '"_..Caption_"'","B") + . Do MApplication.ProcessMessages() + + Set ..FHistoryIndex=..FHistoryIndex-1 + + Quit + +]]> + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +Msg:%String,FontColor:%Integer,ShowTime:%Integer +0 +0 + + + + +%Library.CacheSerialState + +listnode + +Address + + +ClassName + + +CloseFromClient + + +Parent + + +PropName + + +ClassNameAbsent + + +Tag + + +Constraints + + +Font + + +OnCanResize + + +OnClick + + +OnConstrainedResize + + +OnDblClick + + +OnDragDrop + + +OnDragOver + + +OnEndDock + + +OnEndDrag + + +OnMouseDown + + +OnMouseMove + + +OnMouseUp + + +OnResize + + +OnStartDock + + +OnStartDrag + + +PopupMenu + + +FHistoryIndex + + +FTimer + + + + + Index: UI/Lib/Dlg/WebBrowser.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/WebBrowser.cls.xml (revision 0) +++ UI/Lib/Dlg/WebBrowser.cls.xml (revision 61) @@ -0,0 +1,204 @@ + + + +serial +Default +%Library.TMFormClass + + +%Library.TMForm + + + +%TMButton + + + +%TMOleContainer + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +initvalue:%String +cache +0 +%Library.Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +OleContainer1 + + +btnClose + + +ocBrowser + + + + + Index: UI/Lib/Dlg/TPickKlantFromList.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TPickKlantFromList.cls.xml (revision 0) +++ UI/Lib/Dlg/TPickKlantFromList.cls.xml (revision 61) @@ -0,0 +1,510 @@ + + + +0 +0 +serial +0 +KeyCodesCNTs +0 +Default +%Library.TMFormClass +0 + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMBevel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%Library.TMForm +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMLabel +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMSpeedButton +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMListBox +0 +0 + +"" +0 +0 +0 +0 +0 + + + +%TMEdit +0 +0 + +"" +0 +0 +0 +0 +0 + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code + +0 +0 + + + + +0 +0 +code +initvalue:%String +0 +0 + + + + +0 +0 +code +LookUpStr:%String +0 +%Library.Integer +0 + + + + +0 +0 +code +initvalue:%String +0 +%Status +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 + + + + +0 +0 +code +Args:%String +0 +0 +0 Do + .. Do ..lbKlanten.SetFocus() + .. Set ..lbKlanten.ItemIndex=0 + . Else Do + .. Do ..txtNaamNummer.SelectAll() + + ;End of user code + s Args=$lb(Sender,Key,Shift) + q + +]]> + + + +%Library.CacheSerialState + +list + +Address + + +Form + + +Bevel1 + + +btnAnnuleren + + +btnOk + + +lbSortList + + +lbKlanten + + +Bevel2 + + +Label1 + + +txtNaamNummer + + + + + Index: UI/Lib/Dlg/TInputBox.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TInputBox.cls.xml (revision 0) +++ UI/Lib/Dlg/TInputBox.cls.xml (revision 61) @@ -0,0 +1,281 @@ + + + +serial +KeyCodesCNTs +%Library.TMFormClass +0 + + +%Library.TMForm + + + +%TMSpeedButton + + + +%TMSpeedButton + + + +%TMComboBox + + + +%TMLabel + + + +%TMEdit + + + +initvalue:%String +0 +%Status + + + + +0 + + + + +Args:%String +0 + + + + +0 + + + + +initvalue:%String +0 +MApplication + + + + +initvalue:%String +0 +%Status + + + + +Component:%TMWinControl +cache +0 +document +literal + + + + +Args:%String +0 + + + + +Args:%String +0 + + + + +%Library.CacheSerialState + +list +"%Library.TMFormClass" + +Address + + +Form + + +btnAnnuleren + + +btnOk + + +lblMessage + + +txtValue + + +cbbValue + + + + + Index: UI/Lib/Dlg/TSelectDir.cls.xml =================================================================== diff -u --- UI/Lib/Dlg/TSelectDir.cls.xml (revision 0) +++ UI/Lib/Dlg/TSelectDir.cls.xml (revision 61) @@ -0,0 +1,330 @@ + + + +serial +KeyCodesCNTs +Default +%Library.TMFormClass + + +%Library.TMForm + + + +%TMLabel + + + +%TMButton + + + +%TMButton + + + +%TMButton + + + +%TMOleContainer + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +cache +0 +document +literal + + + + +cache +0 +%Library.Boolean +document +literal + + + + +initvalue:%String +cache +0 +MApplication +document +literal + + + + +initvalue:%String +cache +0 +%Status +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +Args:%String +cache +0 +document +literal + + + + +%Library.CacheSerialState + +"%Library.TMFormClass" + +Address + + +Form + + +Button1 + + +Button2 + + +OleContainer1 + + +olDirTree + + +Label1 + + +btnCancel + + +btnOk + + +btnNewMap + + + + +